(1R,3aS,5aR,5bR,7aR,9R,10R,11aR,11bR,13aR,13bR)-10-hydroxy-9-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid
Internal ID | 482b650c-39bb-44a7-a6b3-73e5e4ebad01 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (1R,3aS,5aR,5bR,7aR,9R,10R,11aR,11bR,13aR,13bR)-10-hydroxy-9-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid |
SMILES (Canonical) | CC(=C)C1CCC2(C1C3CCC4C(C3(CC2)C)(CCC5C4(CC(C(C5(C)C)OC(=O)C=CC6=CC(=C(C=C6)O)OC)O)C)C)C(=O)O |
SMILES (Isomeric) | CC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]3CC[C@H]4[C@]([C@@]3(CC2)C)(CC[C@@H]5[C@@]4(C[C@H]([C@@H](C5(C)C)OC(=O)/C=C/C6=CC(=C(C=C6)O)OC)O)C)C)C(=O)O |
InChI | InChI=1S/C40H56O7/c1-23(2)25-15-18-40(35(44)45)20-19-38(6)26(33(25)40)11-13-31-37(5)22-28(42)34(36(3,4)30(37)16-17-39(31,38)7)47-32(43)14-10-24-9-12-27(41)29(21-24)46-8/h9-10,12,14,21,25-26,28,30-31,33-34,41-42H,1,11,13,15-20,22H2,2-8H3,(H,44,45)/b14-10+/t25-,26+,28+,30-,31+,33+,34-,37-,38+,39+,40-/m0/s1 |
InChI Key | PQXUHCMBUXUDTO-QLKYTTSLSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C40H56O7 |
Molecular Weight | 648.90 g/mol |
Exact Mass | 648.40260412 g/mol |
Topological Polar Surface Area (TPSA) | 113.00 Ų |
XlogP | 9.50 |
There are no found synonyms. |
![2D Structure of (1R,3aS,5aR,5bR,7aR,9R,10R,11aR,11bR,13aR,13bR)-10-hydroxy-9-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid 2D Structure of (1R,3aS,5aR,5bR,7aR,9R,10R,11aR,11bR,13aR,13bR)-10-hydroxy-9-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/1a9c7000-8656-11ee-9b5a-23df88d8d9a4.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.58% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.58% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.34% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.97% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.97% | 95.56% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 96.50% | 92.94% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 92.05% | 91.49% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.28% | 95.89% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 91.18% | 91.19% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.72% | 89.00% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 85.96% | 92.98% |
CHEMBL2581 | P07339 | Cathepsin D | 85.74% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.64% | 97.09% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.01% | 89.62% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.72% | 100.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.49% | 97.14% |
CHEMBL3194 | P02766 | Transthyretin | 83.44% | 90.71% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.30% | 91.07% |
CHEMBL2535 | P11166 | Glucose transporter | 82.90% | 98.75% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.83% | 92.62% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.28% | 95.89% |
CHEMBL3788 | O00444 | Serine/threonine-protein kinase PLK4 | 82.00% | 83.65% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.49% | 99.17% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 80.85% | 100.00% |
CHEMBL5028 | O14672 | ADAM10 | 80.25% | 97.50% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.04% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Eucalyptus camaldulensis |
PubChem | 102065962 |
LOTUS | LTS0083855 |
wikiData | Q105213535 |