(2,6-dihydroxy-3,4-dimethoxyphenyl)-[(1R,5R,6R)-4-methyl-5-(3-methylbut-2-enyl)-6-phenylcyclohex-3-en-1-yl]methanone
| Internal ID | 1d8bfb7b-82a4-40e5-8cfb-1d2a87b4e9c4 |
| Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids |
| IUPAC Name | (2,6-dihydroxy-3,4-dimethoxyphenyl)-[(1R,5R,6R)-4-methyl-5-(3-methylbut-2-enyl)-6-phenylcyclohex-3-en-1-yl]methanone |
| SMILES (Canonical) | CC1=CCC(C(C1CC=C(C)C)C2=CC=CC=C2)C(=O)C3=C(C(=C(C=C3O)OC)OC)O |
| SMILES (Isomeric) | CC1=CC[C@H]([C@@H]([C@H]1CC=C(C)C)C2=CC=CC=C2)C(=O)C3=C(C(=C(C=C3O)OC)OC)O |
| InChI | InChI=1S/C27H32O5/c1-16(2)11-13-19-17(3)12-14-20(23(19)18-9-7-6-8-10-18)25(29)24-21(28)15-22(31-4)27(32-5)26(24)30/h6-12,15,19-20,23,28,30H,13-14H2,1-5H3/t19-,20+,23+/m0/s1 |
| InChI Key | INJTZOLDJOVMHP-MIZPHKNDSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C27H32O5 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.22497412 g/mol |
| Topological Polar Surface Area (TPSA) | 76.00 Ų |
| XlogP | 5.90 |
| There are no found synonyms. |
![2D Structure of (2,6-dihydroxy-3,4-dimethoxyphenyl)-[(1R,5R,6R)-4-methyl-5-(3-methylbut-2-enyl)-6-phenylcyclohex-3-en-1-yl]methanone](https://plantaedb.com/storage/docs/compounds/2023/11/1a5e4a80-8657-11ee-b073-7d647976e051.jpg "2D Structure of (2,6-dihydroxy-3,4-dimethoxyphenyl)-[(1R,5R,6R)-4-methyl-5-(3-methylbut-2-enyl)-6-phenylcyclohex-3-en-1-yl]methanone")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.54% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.36% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.63% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.84% | 95.56% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 91.15% | 96.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.30% | 99.17% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.65% | 95.50% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.57% | 94.73% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.92% | 97.21% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.46% | 96.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.46% | 99.15% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.05% | 98.75% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.64% | 95.89% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 80.38% | 94.08% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.06% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Uvaria scheffleri |
| PubChem | 14585492 |
| LOTUS | LTS0101794 |
| wikiData | Q105116247 |