5,7-dihydroxy-3-(4-hydroxyphenyl)-8-[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one
Internal ID | 633c23cf-8306-406a-b984-47544ac315b6 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavonoid C-glycosides |
IUPAC Name | 5,7-dihydroxy-3-(4-hydroxyphenyl)-8-[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one |
SMILES (Canonical) | C1=CC(=CC=C1C2=COC3=C(C2=O)C(=CC(=C3C4C(C(C(C(O4)CO)O)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C2=COC3=C(C2=O)C(=CC(=C3[C@@H]4[C@H]([C@@H]([C@H]([C@@H](O4)CO)O)O)O)O)O)O |
InChI | InChI=1S/C21H20O10/c22-6-13-17(27)18(28)19(29)21(31-13)15-12(25)5-11(24)14-16(26)10(7-30-20(14)15)8-1-3-9(23)4-2-8/h1-5,7,13,17-19,21-25,27-29H,6H2/t13-,17-,18+,19-,21+/m0/s1 |
InChI Key | HIWJJOYYZFELEZ-ZHWWATJMSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H20O10 |
Molecular Weight | 432.40 g/mol |
Exact Mass | 432.10564683 g/mol |
Topological Polar Surface Area (TPSA) | 177.00 Ų |
XlogP | 0.20 |
There are no found synonyms. |
![2D Structure of 5,7-dihydroxy-3-(4-hydroxyphenyl)-8-[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one 2D Structure of 5,7-dihydroxy-3-(4-hydroxyphenyl)-8-[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/1a56d640-859f-11ee-a132-998fba9a4ebd.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.82% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.21% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.63% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.54% | 94.00% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 88.24% | 96.21% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.21% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.86% | 99.15% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.60% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.31% | 94.73% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.21% | 86.92% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.74% | 91.71% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 81.85% | 93.10% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.81% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lupinus luteus |
PubChem | 162941822 |
LOTUS | LTS0179464 |
wikiData | Q105029071 |