1a,5-Dimethyl-8-propan-2-yl-2,3,4,4a,5,6,7,8-octahydronaphtho[1,8a-b]oxirene-2,6-diol
| Internal ID | d17ceeab-a029-477b-a173-5c01ebed40b7 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Menthane monoterpenoids |
| IUPAC Name | 1a,5-dimethyl-8-propan-2-yl-2,3,4,4a,5,6,7,8-octahydronaphtho[1,8a-b]oxirene-2,6-diol |
| SMILES (Canonical) | CC1C2CCC(C3(C2(O3)C(CC1O)C(C)C)C)O |
| SMILES (Isomeric) | CC1C2CCC(C3(C2(O3)C(CC1O)C(C)C)C)O |
| InChI | InChI=1S/C15H26O3/c1-8(2)11-7-12(16)9(3)10-5-6-13(17)14(4)15(10,11)18-14/h8-13,16-17H,5-7H2,1-4H3 |
| InChI Key | KALHVLRQNHIJOX-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.18819469 g/mol |
| Topological Polar Surface Area (TPSA) | 53.00 Ų |
| XlogP | 2.00 |
| There are no found synonyms. |
![2D Structure of 1a,5-Dimethyl-8-propan-2-yl-2,3,4,4a,5,6,7,8-octahydronaphtho[1,8a-b]oxirene-2,6-diol](https://plantaedb.com/storage/docs/compounds/2023/11/1a5-dimethyl-8-propan-2-yl-2344a5678-octahydronaphtho18a-boxirene-26-diol.jpg "2D Structure of 1a,5-Dimethyl-8-propan-2-yl-2,3,4,4a,5,6,7,8-octahydronaphtho[1,8a-b]oxirene-2,6-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.99% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.57% | 96.09% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 89.34% | 97.79% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 88.89% | 98.10% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.73% | 97.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 87.75% | 95.93% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 85.06% | 99.18% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.57% | 91.11% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 84.48% | 96.61% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.33% | 100.00% |
| CHEMBL3045 | P05771 | Protein kinase C beta | 83.89% | 97.63% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.61% | 95.89% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 82.67% | 96.38% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.11% | 95.89% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 81.15% | 95.58% |
| CHEMBL4444 | P04070 | Vitamin K-dependent protein C | 81.04% | 93.89% |
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 80.16% | 98.46% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 80.01% | 98.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163023226 |
| LOTUS | LTS0085493 |
| wikiData | Q104170069 |