(10S,13R)-4,5,17-trimethoxy-11-methyl-2-oxa-11-azatetracyclo[8.7.1.03,8.014,18]octadeca-1(17),3(8),4,6,14(18),15-hexaen-13-ol
Internal ID | bdb974df-abec-4e54-9782-88ecbcc75890 |
Taxonomy | Alkaloids and derivatives > Cularin alkaloids and derivatives |
IUPAC Name | (10S,13R)-4,5,17-trimethoxy-11-methyl-2-oxa-11-azatetracyclo[8.7.1.03,8.014,18]octadeca-1(17),3(8),4,6,14(18),15-hexaen-13-ol |
SMILES (Canonical) | CN1CC(C2=C3C1CC4=C(C(=C(C=C4)OC)OC)OC3=C(C=C2)OC)O |
SMILES (Isomeric) | CN1C[C@@H](C2=C3[C@@H]1CC4=C(C(=C(C=C4)OC)OC)OC3=C(C=C2)OC)O |
InChI | InChI=1S/C20H23NO5/c1-21-10-14(22)12-6-8-15(23-2)19-17(12)13(21)9-11-5-7-16(24-3)20(25-4)18(11)26-19/h5-8,13-14,22H,9-10H2,1-4H3/t13-,14-/m0/s1 |
InChI Key | ITVKPOQYPPYHQA-KBPBESRZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H23NO5 |
Molecular Weight | 357.40 g/mol |
Exact Mass | 357.15762283 g/mol |
Topological Polar Surface Area (TPSA) | 60.40 Ų |
XlogP | 2.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.13% | 96.09% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 93.92% | 95.62% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 88.17% | 83.82% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.11% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 86.71% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.38% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.25% | 94.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.41% | 93.56% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.28% | 89.62% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.48% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.78% | 95.56% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.86% | 95.89% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.46% | 93.99% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.19% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Sarcocapnos enneaphylla |
PubChem | 101601085 |
LOTUS | LTS0270625 |
wikiData | Q105120324 |