2-(3,4-dihydroxyphenyl)-5-hydroxy-6,8-dimethoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one
Internal ID | c8826a43-ec69-48c5-af26-c356d837ac67 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 2-(3,4-dihydroxyphenyl)-5-hydroxy-6,8-dimethoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | COC1=C(C(=C2C(=C1O)C(=O)C=C(O2)C3=CC(=C(C=C3)O)O)OC)OC4C(C(C(C(O4)CO)O)O)O |
SMILES (Isomeric) | COC1=C(C(=C2C(=C1O)C(=O)C=C(O2)C3=CC(=C(C=C3)O)O)OC)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O |
InChI | InChI=1S/C23H24O13/c1-32-20-16(29)14-11(27)6-12(8-3-4-9(25)10(26)5-8)34-19(14)21(33-2)22(20)36-23-18(31)17(30)15(28)13(7-24)35-23/h3-6,13,15,17-18,23-26,28-31H,7H2,1-2H3/t13-,15-,17+,18-,23+/m1/s1 |
InChI Key | IECBXLUOFRZUBN-FTVHLUNLSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H24O13 |
Molecular Weight | 508.40 g/mol |
Exact Mass | 508.12169082 g/mol |
Topological Polar Surface Area (TPSA) | 205.00 Ų |
XlogP | 0.40 |
There are no found synonyms. |
![2D Structure of 2-(3,4-dihydroxyphenyl)-5-hydroxy-6,8-dimethoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one 2D Structure of 2-(3,4-dihydroxyphenyl)-5-hydroxy-6,8-dimethoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/1a0c8e30-83fa-11ee-8e12-2d3ba850fb11.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.74% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.95% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.82% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.03% | 85.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.27% | 89.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.02% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.06% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.06% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.78% | 94.45% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 88.33% | 86.92% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.32% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.07% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.24% | 96.09% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 83.88% | 95.64% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 82.81% | 91.49% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.55% | 97.09% |
CHEMBL3194 | P02766 | Transthyretin | 81.28% | 90.71% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 81.16% | 83.57% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.41% | 95.83% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.00% | 96.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Sideritis leucantha |
PubChem | 162923910 |
LOTUS | LTS0117355 |
wikiData | Q105111692 |