1a-methyl-5-(2-phenylethyl)-2,7b-dihydro-1H-cyclopropa[c]chromen-7-ol
| Internal ID | 976b3cd2-ee56-4bec-b247-680574c2c37c |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | 1a-methyl-5-(2-phenylethyl)-2,7b-dihydro-1H-cyclopropa[c]chromen-7-ol |
| SMILES (Canonical) | CC12CC1C3=C(C=C(C=C3OC2)CCC4=CC=CC=C4)O |
| SMILES (Isomeric) | CC12CC1C3=C(C=C(C=C3OC2)CCC4=CC=CC=C4)O |
| InChI | InChI=1S/C19H20O2/c1-19-11-15(19)18-16(20)9-14(10-17(18)21-12-19)8-7-13-5-3-2-4-6-13/h2-6,9-10,15,20H,7-8,11-12H2,1H3 |
| InChI Key | WDDPYCJVJMDZKP-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.146329876 g/mol |
| Topological Polar Surface Area (TPSA) | 29.50 Ų |
| XlogP | 4.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.33% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.75% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.36% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.96% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.89% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.67% | 95.56% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 88.86% | 94.62% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 86.86% | 92.51% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 83.50% | 85.11% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 82.73% | 96.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.64% | 97.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.53% | 90.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.50% | 97.25% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 81.42% | 100.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.09% | 94.73% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 81.08% | 93.81% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Radula javanica |
| PubChem | 14804134 |
| LOTUS | LTS0044851 |
| wikiData | Q105302285 |