7'-hydroxy-4',4',7,7-tetramethylspiro[1H-pyrano[2,3-g]indole-2,5'-6-oxa-10,15-diazatetracyclo[6.5.2.01,10.03,8]pentadecane]-3,9',14'-trione
| Internal ID | b4a7b668-162a-41f6-b478-257004a93e88 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > 2,2-dimethyl-1-benzopyrans |
| IUPAC Name | 7'-hydroxy-4',4',7,7-tetramethylspiro[1H-pyrano[2,3-g]indole-2,5'-6-oxa-10,15-diazatetracyclo[6.5.2.01,10.03,8]pentadecane]-3,9',14'-trione |
| SMILES (Canonical) | CC1(C=CC2=C(O1)C=CC3=C2NC4(C3=O)C(C5CC67CCCN6C(=O)C5(C(O4)O)NC7=O)(C)C)C |
| SMILES (Isomeric) | CC1(C=CC2=C(O1)C=CC3=C2NC4(C3=O)C(C5CC67CCCN6C(=O)C5(C(O4)O)NC7=O)(C)C)C |
| InChI | InChI=1S/C26H29N3O6/c1-22(2)10-8-13-15(34-22)7-6-14-17(13)27-26(18(14)30)23(3,4)16-12-24-9-5-11-29(24)20(32)25(16,21(33)35-26)28-19(24)31/h6-8,10,16,21,27,33H,5,9,11-12H2,1-4H3,(H,28,31) |
| InChI Key | ZPXKISNDQRGXBE-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H29N3O6 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.20563565 g/mol |
| Topological Polar Surface Area (TPSA) | 117.00 Ų |
| XlogP | 1.90 |
| There are no found synonyms. |
![2D Structure of 7'-hydroxy-4',4',7,7-tetramethylspiro[1H-pyrano[2,3-g]indole-2,5'-6-oxa-10,15-diazatetracyclo[6.5.2.01,10.03,8]pentadecane]-3,9',14'-trione](https://plantaedb.com/storage/docs/compounds/2023/11/19f1ed80-8428-11ee-b3b2-2562efd6dd26.jpg "2D Structure of 7'-hydroxy-4',4',7,7-tetramethylspiro[1H-pyrano[2,3-g]indole-2,5'-6-oxa-10,15-diazatetracyclo[6.5.2.01,10.03,8]pentadecane]-3,9',14'-trione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.23% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.73% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.37% | 91.11% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 94.75% | 93.40% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.92% | 85.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.83% | 89.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.44% | 97.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.09% | 94.45% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 90.93% | 95.34% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 89.85% | 96.77% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.78% | 94.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.48% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.44% | 99.23% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 88.67% | 93.04% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.61% | 90.71% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.54% | 90.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 87.49% | 91.49% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.24% | 100.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.10% | 86.33% |
| CHEMBL3012 | Q13946 | Phosphodiesterase 7A | 84.04% | 99.29% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 83.66% | 88.56% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 83.19% | 90.24% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 82.65% | 97.28% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.37% | 93.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.22% | 95.89% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.81% | 97.25% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.61% | 90.17% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.51% | 92.88% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 75254442 |
| LOTUS | LTS0057314 |
| wikiData | Q104202672 |