Dimethyl 19-formyl-22-oxo-6,8-dioxa-11,19-diazahexacyclo[13.5.3.01,12.02,10.05,9.015,20]tricosa-2(10),3,5(9)-triene-11,12-dicarboxylate
| Internal ID | 8b947291-3902-45a8-8e92-d83b87ce6082 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | dimethyl 19-formyl-22-oxo-6,8-dioxa-11,19-diazahexacyclo[13.5.3.01,12.02,10.05,9.015,20]tricosa-2(10),3,5(9)-triene-11,12-dicarboxylate |
| SMILES (Canonical) | COC(=O)C12CCC34CCCN(C3C1(CC(=O)C4)C5=C(N2C(=O)OC)C6=C(C=C5)OCO6)C=O |
| SMILES (Isomeric) | COC(=O)C12CCC34CCCN(C3C1(CC(=O)C4)C5=C(N2C(=O)OC)C6=C(C=C5)OCO6)C=O |
| InChI | InChI=1S/C24H26N2O8/c1-31-20(29)24-8-7-22-6-3-9-25(12-27)19(22)23(24,11-14(28)10-22)15-4-5-16-18(34-13-33-16)17(15)26(24)21(30)32-2/h4-5,12,19H,3,6-11,13H2,1-2H3 |
| InChI Key | JHZSPIZZIWORMX-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H26N2O8 |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.16891579 g/mol |
| Topological Polar Surface Area (TPSA) | 112.00 Ų |
| XlogP | 1.20 |
| There are no found synonyms. |
![2D Structure of Dimethyl 19-formyl-22-oxo-6,8-dioxa-11,19-diazahexacyclo[13.5.3.01,12.02,10.05,9.015,20]tricosa-2(10),3,5(9)-triene-11,12-dicarboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/19bbd520-85fe-11ee-b826-17b34b120274.jpg "2D Structure of Dimethyl 19-formyl-22-oxo-6,8-dioxa-11,19-diazahexacyclo[13.5.3.01,12.02,10.05,9.015,20]tricosa-2(10),3,5(9)-triene-11,12-dicarboxylate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 98.25% | 96.77% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.98% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.68% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.13% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.90% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.20% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.82% | 85.14% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 92.03% | 90.00% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 90.19% | 85.30% |
| CHEMBL5028 | O14672 | ADAM10 | 88.69% | 97.50% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.71% | 100.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.58% | 92.62% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.29% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.53% | 99.23% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 82.35% | 80.96% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.85% | 91.19% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.11% | 94.33% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.72% | 93.04% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.71% | 89.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.14% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Kopsia dasyrachis |
| PubChem | 73193302 |
| LOTUS | LTS0057042 |
| wikiData | Q105128853 |