[(1R,2R,4R,6R,8S,9Z,11R)-4,9-dimethyl-14-methylidene-8-(2-methylpropanoyloxy)-13-oxo-5,12-dioxatricyclo[9.3.0.04,6]tetradec-9-en-2-yl] (2R,3R)-2,3-dimethyloxirane-2-carboxylate
| Internal ID | 2e5d7374-ab18-4273-bf24-40a542ab1b20 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Sesquiterpene lactones > Germacranolides and derivatives |
| IUPAC Name | [(1R,2R,4R,6R,8S,9Z,11R)-4,9-dimethyl-14-methylidene-8-(2-methylpropanoyloxy)-13-oxo-5,12-dioxatricyclo[9.3.0.04,6]tetradec-9-en-2-yl] (2R,3R)-2,3-dimethyloxirane-2-carboxylate |
| SMILES (Canonical) | CC1C(O1)(C)C(=O)OC2CC3(C(O3)CC(C(=CC4C2C(=C)C(=O)O4)C)OC(=O)C(C)C)C |
| SMILES (Isomeric) | C[C@@H]1[C@](O1)(C)C(=O)O[C@@H]2C[C@@]3([C@H](O3)C[C@@H](/C(=C\[C@@H]4[C@@H]2C(=C)C(=O)O4)/C)OC(=O)C(C)C)C |
| InChI | InChI=1S/C24H32O8/c1-11(2)20(25)28-15-9-18-23(6,32-18)10-17(30-22(27)24(7)14(5)31-24)19-13(4)21(26)29-16(19)8-12(15)3/h8,11,14-19H,4,9-10H2,1-3,5-7H3/b12-8-/t14-,15+,16-,17-,18-,19+,23-,24-/m1/s1 |
| InChI Key | GOFRQGLUPQJGNY-DMHZLVBZSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H32O8 |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.20971797 g/mol |
| Topological Polar Surface Area (TPSA) | 104.00 Ų |
| XlogP | 2.60 |
| There are no found synonyms. |
![2D Structure of [(1R,2R,4R,6R,8S,9Z,11R)-4,9-dimethyl-14-methylidene-8-(2-methylpropanoyloxy)-13-oxo-5,12-dioxatricyclo[9.3.0.04,6]tetradec-9-en-2-yl] (2R,3R)-2,3-dimethyloxirane-2-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/19a11ee0-8479-11ee-a0cf-2dcfbdefc60c.jpg "2D Structure of [(1R,2R,4R,6R,8S,9Z,11R)-4,9-dimethyl-14-methylidene-8-(2-methylpropanoyloxy)-13-oxo-5,12-dioxatricyclo[9.3.0.04,6]tetradec-9-en-2-yl] (2R,3R)-2,3-dimethyloxirane-2-carboxylate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.11% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.97% | 97.25% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.10% | 95.56% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 91.31% | 89.63% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.31% | 97.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.29% | 90.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.13% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.10% | 86.33% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.07% | 91.19% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.01% | 99.23% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 87.51% | 96.47% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.00% | 97.14% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.93% | 91.07% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 85.22% | 97.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.96% | 89.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.27% | 96.09% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 82.85% | 97.79% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.71% | 93.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.13% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.75% | 98.95% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.18% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dendroviguiera eriophora |
| Tithonia rotundifolia |
| PubChem | 162855151 |
| LOTUS | LTS0095057 |
| wikiData | Q105013845 |