3,5,7-trihydroxy-2-(4-hydroxyphenyl)-8-[(2R,3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]chromen-4-one
Internal ID | a1ff1fcd-864c-4f29-9047-e6f46417da42 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones > Flavonols |
IUPAC Name | 3,5,7-trihydroxy-2-(4-hydroxyphenyl)-8-[(2R,3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]chromen-4-one |
SMILES (Canonical) | C1=CC(=CC=C1C2=C(C(=O)C3=C(O2)C(=C(C=C3O)O)C4C(C(C(OC4O)CO)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C2=C(C(=O)C3=C(O2)C(=C(C=C3O)O)[C@@H]4[C@H]([C@@H]([C@H](O[C@H]4O)CO)O)O)O)O |
InChI | InChI=1S/C21H20O11/c22-6-11-15(26)17(28)14(21(30)31-11)12-9(24)5-10(25)13-16(27)18(29)19(32-20(12)13)7-1-3-8(23)4-2-7/h1-5,11,14-15,17,21-26,28-30H,6H2/t11-,14-,15-,17-,21-/m1/s1 |
InChI Key | TWWBWJRDKKSQAW-KZHUKFLJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H20O11 |
Molecular Weight | 448.40 g/mol |
Exact Mass | 448.10056145 g/mol |
Topological Polar Surface Area (TPSA) | 197.00 Ų |
XlogP | 0.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.64% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.89% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 95.71% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.01% | 94.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.76% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.46% | 94.73% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.93% | 99.15% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 86.22% | 95.64% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.96% | 90.71% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 85.60% | 91.71% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.54% | 86.92% |
CHEMBL3194 | P02766 | Transthyretin | 84.22% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.84% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.91% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.89% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cyclopia intermedia |
PubChem | 162992473 |
LOTUS | LTS0175306 |
wikiData | Q105266153 |