(2S)-2-[[2-[[2-[[(2R)-6-amino-2-[[(2R)-2-[[(1S)-5-[(4-amino-4-oxobutanoyl)amino]-8-hydroxy-9-oxo-1,2,3,4-tetrahydropyrimido[1,2-a]quinoline-1-carbonyl]amino]propanoyl]amino]hexanoyl]amino]acetyl]amino]acetyl]-hydroxyamino]-N-[(1R)-4-amino-1-[6-[[(2S)-3-hydroxy-1-[[(2R)-1-[[(3S)-1-methyl-2-oxopiperidin-3-yl]amino]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]carbamoyl]-1,4,5,6-tetrahydropyrimidin-2-yl]-4-oxobutyl]butanediamide
| Internal ID | 7a4cc452-e649-47d0-a761-874ac879a651 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides |
| IUPAC Name | (2S)-2-[[2-[[2-[[(2R)-6-amino-2-[[(2R)-2-[[(1S)-5-[(4-amino-4-oxobutanoyl)amino]-8-hydroxy-9-oxo-1,2,3,4-tetrahydropyrimido[1,2-a]quinoline-1-carbonyl]amino]propanoyl]amino]hexanoyl]amino]acetyl]amino]acetyl]-hydroxyamino]-N-[(1R)-4-amino-1-[6-[[(2S)-3-hydroxy-1-[[(2R)-1-[[(3S)-1-methyl-2-oxopiperidin-3-yl]amino]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]carbamoyl]-1,4,5,6-tetrahydropyrimidin-2-yl]-4-oxobutyl]butanediamide |
| SMILES (Canonical) | CC(C(=O)NC(CCCCN)C(=O)NCC(=O)NCC(=O)N(C(CC(=O)N)C(=O)NC(CCC(=O)N)C1=NCCC(N1)C(=O)NC(CO)C(=O)NC(C)C(=O)NC2CCCN(C2=O)C)O)NC(=O)C3CCNC4=C(C=C5C=C(C(=O)C=C5N34)O)NC(=O)CCC(=O)N |
| SMILES (Isomeric) | C[C@H](C(=O)N[C@H](CCCCN)C(=O)NCC(=O)NCC(=O)N([C@@H](CC(=O)N)C(=O)N[C@H](CCC(=O)N)C1=NCCC(N1)C(=O)N[C@@H](CO)C(=O)N[C@H](C)C(=O)N[C@H]2CCCN(C2=O)C)O)NC(=O)[C@@H]3CCNC4=C(C=C5C=C(C(=O)C=C5N34)O)NC(=O)CCC(=O)N |
| InChI | InChI=1S/C55H81N19O18/c1-26(49(85)70-32-8-6-18-72(3)55(32)91)64-52(88)34(25-75)71-51(87)31-13-16-60-46(67-31)29(9-10-40(57)78)68-54(90)37(22-42(59)80)74(92)45(83)24-62-44(82)23-63-50(86)30(7-4-5-15-56)69-48(84)27(2)65-53(89)35-14-17-61-47-33(66-43(81)12-11-41(58)79)19-28-20-38(76)39(77)21-36(28)73(35)47/h19-21,26-27,29-32,34-35,37,61,75-76,92H,4-18,22-25,56H2,1-3H3,(H2,57,78)(H2,58,79)(H2,59,80)(H,60,67)(H,62,82)(H,63,86)(H,64,88)(H,65,89)(H,66,81)(H,68,90)(H,69,84)(H,70,85)(H,71,87)/t26-,27-,29-,30-,31?,32+,34+,35+,37+/m1/s1 |
| InChI Key | ZPQGHTFEPMCGAB-IKJDVBAPSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C55H81N19O18 |
| Molecular Weight | 1296.30 g/mol |
| Exact Mass | 1295.60069681 g/mol |
| Topological Polar Surface Area (TPSA) | 575.00 Ų |
| XlogP | -9.30 |
| Atomic LogP (AlogP) | -7.74 |
| H-Bond Acceptor | 23 |
| H-Bond Donor | 18 |
| Rotatable Bonds | 33 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.8339 | 83.39% |
| Caco-2 | - | 0.8627 | 86.27% |
| Blood Brain Barrier | - | 0.7000 | 70.00% |
| Human oral bioavailability | - | 0.6143 | 61.43% |
| Subcellular localzation | Nucleus | 0.5754 | 57.54% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8191 | 81.91% |
| OATP1B3 inhibitior | + | 0.9310 | 93.10% |
| MATE1 inhibitior | - | 0.7200 | 72.00% |
| OCT2 inhibitior | - | 0.7500 | 75.00% |
| BSEP inhibitior | + | 0.8967 | 89.67% |
| P-glycoprotein inhibitior | + | 0.7422 | 74.22% |
| P-glycoprotein substrate | + | 0.8699 | 86.99% |
| CYP3A4 substrate | + | 0.7593 | 75.93% |
| CYP2C9 substrate | - | 0.5961 | 59.61% |
| CYP2D6 substrate | - | 0.8358 | 83.58% |
| CYP3A4 inhibition | - | 0.6008 | 60.08% |
| CYP2C9 inhibition | - | 0.7653 | 76.53% |
| CYP2C19 inhibition | - | 0.8013 | 80.13% |
| CYP2D6 inhibition | - | 0.7879 | 78.79% |
| CYP1A2 inhibition | - | 0.8326 | 83.26% |
| CYP2C8 inhibition | + | 0.8311 | 83.11% |
| CYP inhibitory promiscuity | - | 0.9624 | 96.24% |
| UGT catelyzed | + | 0.9000 | 90.00% |
| Carcinogenicity (binary) | - | 0.7900 | 79.00% |
| Carcinogenicity (trinary) | Non-required | 0.5766 | 57.66% |
| Eye corrosion | - | 0.9815 | 98.15% |
| Eye irritation | - | 0.8962 | 89.62% |
| Skin irritation | - | 0.7569 | 75.69% |
| Skin corrosion | - | 0.9216 | 92.16% |
| Ames mutagenesis | - | 0.6070 | 60.70% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6749 | 67.49% |
| Micronuclear | + | 0.8400 | 84.00% |
| Hepatotoxicity | - | 0.5144 | 51.44% |
| skin sensitisation | - | 0.8284 | 82.84% |
| Respiratory toxicity | + | 0.8111 | 81.11% |
| Reproductive toxicity | + | 0.9556 | 95.56% |
| Mitochondrial toxicity | + | 0.9500 | 95.00% |
| Nephrotoxicity | - | 0.5694 | 56.94% |
| Acute Oral Toxicity (c) | III | 0.6176 | 61.76% |
| Estrogen receptor binding | + | 0.5800 | 58.00% |
| Androgen receptor binding | + | 0.7552 | 75.52% |
| Thyroid receptor binding | + | 0.6416 | 64.16% |
| Glucocorticoid receptor binding | + | 0.6987 | 69.87% |
| Aromatase binding | + | 0.7572 | 75.72% |
| PPAR gamma | + | 0.7067 | 70.67% |
| Honey bee toxicity | - | 0.6382 | 63.82% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | - | 0.5400 | 54.00% |
| Fish aquatic toxicity | - | 0.5087 | 50.87% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.93% | 98.95% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.92% | 83.82% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 99.79% | 94.45% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 99.64% | 89.63% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 99.46% | 93.10% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 99.32% | 98.05% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.25% | 96.09% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 98.36% | 98.33% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 98.12% | 95.71% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 97.93% | 98.24% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 97.19% | 82.69% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.72% | 97.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.50% | 99.17% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 96.39% | 90.71% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 96.39% | 95.38% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 95.75% | 94.75% |
| CHEMBL236 | P41143 | Delta opioid receptor | 95.60% | 99.35% |
| CHEMBL2593 | P30419 | Peptide N-myristoyltransferase 1 | 94.39% | 93.45% |
| CHEMBL2208 | P49137 | MAP kinase-activated protein kinase 2 | 93.78% | 95.20% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 92.92% | 94.66% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 92.55% | 100.00% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 92.17% | 91.03% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.14% | 91.11% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.95% | 96.00% |
| CHEMBL4235 | P28845 | 11-beta-hydroxysteroid dehydrogenase 1 | 91.59% | 97.98% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 91.36% | 95.00% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 91.18% | 80.71% |
| CHEMBL249 | P25103 | Neurokinin 1 receptor | 91.15% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.09% | 94.45% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 91.00% | 100.00% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 90.54% | 97.23% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.96% | 99.23% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 89.88% | 82.38% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 89.85% | 96.11% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 89.72% | 95.50% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 89.67% | 94.33% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 89.64% | 97.14% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 89.38% | 100.00% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 89.18% | 98.59% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 88.56% | 90.20% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 88.24% | 96.90% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 87.94% | 97.64% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 87.92% | 90.08% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 87.58% | 96.47% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 87.55% | 97.53% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 87.24% | 95.83% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.78% | 93.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.01% | 95.89% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 85.92% | 82.86% |
| CHEMBL4015 | P41597 | C-C chemokine receptor type 2 | 85.62% | 98.57% |
| CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 85.36% | 93.33% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 84.57% | 97.56% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.29% | 100.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.41% | 99.15% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 83.35% | 91.38% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.76% | 91.19% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.34% | 95.56% |
| CHEMBL204 | P00734 | Thrombin | 82.23% | 96.01% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.32% | 89.00% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 80.59% | 97.50% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 80.41% | 95.00% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 80.27% | 89.34% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.14% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163187306 |
| LOTUS | LTS0026290 |
| wikiData | Q105381117 |