[(2S,3aS,6R,7aS)-2-[4-(diaminomethylideneamino)butylcarbamoyl]-1-[(2R,3R)-2-[[(2R)-3-(3,5-dichloro-4-hydroxyphenyl)-2-hydroxypropanoyl]amino]-3-methylpentanoyl]-2,3,3a,4,5,6,7,7a-octahydroindol-6-yl] hydrogen sulfate
| Internal ID | 0c783db6-44eb-4a4e-b0bb-c9c1fd41099f |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Dipeptides |
| IUPAC Name | [(2S,3aS,6R,7aS)-2-[4-(diaminomethylideneamino)butylcarbamoyl]-1-[(2R,3R)-2-[[(2R)-3-(3,5-dichloro-4-hydroxyphenyl)-2-hydroxypropanoyl]amino]-3-methylpentanoyl]-2,3,3a,4,5,6,7,7a-octahydroindol-6-yl] hydrogen sulfate |
| SMILES (Canonical) | CCC(C)C(C(=O)N1C2CC(CCC2CC1C(=O)NCCCCN=C(N)N)OS(=O)(=O)O)NC(=O)C(CC3=CC(=C(C(=C3)Cl)O)Cl)O |
| SMILES (Isomeric) | CC[C@@H](C)[C@H](C(=O)N1[C@H]2C[C@@H](CC[C@H]2C[C@H]1C(=O)NCCCCN=C(N)N)OS(=O)(=O)O)NC(=O)[C@@H](CC3=CC(=C(C(=C3)Cl)O)Cl)O |
| InChI | InChI=1S/C29H44Cl2N6O9S/c1-3-15(2)24(36-27(41)23(38)12-16-10-19(30)25(39)20(31)11-16)28(42)37-21-14-18(46-47(43,44)45)7-6-17(21)13-22(37)26(40)34-8-4-5-9-35-29(32)33/h10-11,15,17-18,21-24,38-39H,3-9,12-14H2,1-2H3,(H,34,40)(H,36,41)(H4,32,33,35)(H,43,44,45)/t15-,17+,18-,21+,22+,23-,24-/m1/s1 |
| InChI Key | RLHOQMQWBDVOPM-SXCQRHIVSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C29H44Cl2N6O9S |
| Molecular Weight | 723.70 g/mol |
| Exact Mass | 722.2267536 g/mol |
| Topological Polar Surface Area (TPSA) | 255.00 Ų |
| XlogP | 1.90 |
| Atomic LogP (AlogP) | 1.26 |
| H-Bond Acceptor | 9 |
| H-Bond Donor | 7 |
| Rotatable Bonds | 15 |
| CHEBI:223969 |
| [(2S,3aS,6R,7aS)-2-[4-(diaminomethylideneamino)butylcarbamoyl]-1-[(2R,3R)-2-[[(2R)-3-(3,5-dichloro-4-hydroxyphenyl)-2-hydroxypropanoyl]amino]-3-methylpentanoyl]-2,3,3a,4,5,6,7,7a-octahydroindol-6-yl] hydrogen sulate |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9279 | 92.79% |
| Caco-2 | - | 0.8625 | 86.25% |
| Blood Brain Barrier | - | 0.5250 | 52.50% |
| Human oral bioavailability | - | 0.6857 | 68.57% |
| Subcellular localzation | Mitochondria | 0.4044 | 40.44% |
| OATP2B1 inhibitior | - | 0.7124 | 71.24% |
| OATP1B1 inhibitior | + | 0.8086 | 80.86% |
| OATP1B3 inhibitior | + | 0.9363 | 93.63% |
| MATE1 inhibitior | - | 0.8000 | 80.00% |
| OCT2 inhibitior | + | 0.5250 | 52.50% |
| BSEP inhibitior | + | 0.9059 | 90.59% |
| P-glycoprotein inhibitior | + | 0.7179 | 71.79% |
| P-glycoprotein substrate | + | 0.8553 | 85.53% |
| CYP3A4 substrate | + | 0.7308 | 73.08% |
| CYP2C9 substrate | - | 0.6120 | 61.20% |
| CYP2D6 substrate | - | 0.7884 | 78.84% |
| CYP3A4 inhibition | - | 0.5172 | 51.72% |
| CYP2C9 inhibition | - | 0.6886 | 68.86% |
| CYP2C19 inhibition | - | 0.6361 | 63.61% |
| CYP2D6 inhibition | - | 0.8358 | 83.58% |
| CYP1A2 inhibition | - | 0.7334 | 73.34% |
| CYP2C8 inhibition | + | 0.6393 | 63.93% |
| CYP inhibitory promiscuity | - | 0.7338 | 73.38% |
| UGT catelyzed | + | 0.9000 | 90.00% |
| Carcinogenicity (binary) | + | 0.5065 | 50.65% |
| Carcinogenicity (trinary) | Non-required | 0.5733 | 57.33% |
| Eye corrosion | - | 0.9766 | 97.66% |
| Eye irritation | - | 0.9260 | 92.60% |
| Skin irritation | - | 0.7531 | 75.31% |
| Skin corrosion | - | 0.9094 | 90.94% |
| Ames mutagenesis | - | 0.6054 | 60.54% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.4827 | 48.27% |
| Micronuclear | + | 0.9200 | 92.00% |
| Hepatotoxicity | - | 0.5347 | 53.47% |
| skin sensitisation | - | 0.8257 | 82.57% |
| Respiratory toxicity | + | 0.7778 | 77.78% |
| Reproductive toxicity | + | 0.9000 | 90.00% |
| Mitochondrial toxicity | + | 0.6500 | 65.00% |
| Nephrotoxicity | - | 0.8205 | 82.05% |
| Acute Oral Toxicity (c) | III | 0.5723 | 57.23% |
| Estrogen receptor binding | + | 0.8148 | 81.48% |
| Androgen receptor binding | + | 0.7008 | 70.08% |
| Thyroid receptor binding | + | 0.5683 | 56.83% |
| Glucocorticoid receptor binding | + | 0.6419 | 64.19% |
| Aromatase binding | + | 0.6266 | 62.66% |
| PPAR gamma | + | 0.7193 | 71.93% |
| Honey bee toxicity | - | 0.7326 | 73.26% |
| Biodegradation | - | 0.8000 | 80.00% |
| Crustacea aquatic toxicity | - | 0.5700 | 57.00% |
| Fish aquatic toxicity | + | 0.9700 | 97.00% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.70% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.54% | 96.09% |
| CHEMBL4072 | P07858 | Cathepsin B | 98.96% | 93.67% |
| CHEMBL204 | P00734 | Thrombin | 98.00% | 96.01% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.69% | 94.45% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 97.22% | 95.34% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 97.15% | 97.21% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 97.09% | 95.52% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 96.66% | 96.76% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.21% | 91.11% |
| CHEMBL4506 | Q96EB6 | NAD-dependent deacetylase sirtuin 1 | 96.19% | 88.33% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 96.16% | 85.31% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 95.71% | 83.82% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 95.28% | 98.05% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 94.74% | 91.19% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 94.74% | 98.33% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 93.88% | 100.00% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 93.64% | 94.66% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 93.50% | 96.25% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 92.62% | 100.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.79% | 96.00% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 91.64% | 96.38% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 90.93% | 90.71% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.65% | 97.09% |
| CHEMBL238 | Q01959 | Dopamine transporter | 89.86% | 95.88% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 89.64% | 96.90% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 89.61% | 96.67% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.50% | 95.89% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 89.44% | 98.59% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 89.30% | 97.50% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.82% | 97.25% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.65% | 93.56% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 88.59% | 96.21% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.03% | 95.89% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 87.49% | 95.58% |
| CHEMBL5646 | Q6L5J4 | FML2_HUMAN | 86.75% | 100.00% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 86.74% | 100.00% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 86.62% | 93.03% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 85.31% | 89.33% |
| CHEMBL5028 | O14672 | ADAM10 | 85.21% | 97.50% |
| CHEMBL3788 | O00444 | Serine/threonine-protein kinase PLK4 | 84.74% | 83.65% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.42% | 95.56% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 83.69% | 80.71% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 83.69% | 96.11% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.41% | 94.33% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 82.97% | 90.24% |
| CHEMBL3729 | P22748 | Carbonic anhydrase IV | 82.90% | 99.23% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.83% | 96.95% |
| CHEMBL4805 | Q99572 | P2X purinoceptor 7 | 82.69% | 97.50% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 82.32% | 97.29% |
| CHEMBL3837 | P07711 | Cathepsin L | 82.26% | 96.61% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.91% | 97.14% |
| CHEMBL3055 | P50613 | Cyclin-dependent kinase 7 | 81.82% | 81.88% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 81.31% | 91.03% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 81.28% | 85.11% |
| CHEMBL222 | P23975 | Norepinephrine transporter | 80.98% | 96.06% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10556839 |
| LOTUS | LTS0117159 |
| wikiData | Q77508263 |