2-[(2S,3R,4S,5S,6S)-6-[(1R)-1-[(2R,5S,7S,8R,9R)-2-[(2R,5R)-5-[(2R,3R,5R)-3-[(2S,4S,5S,6S)-4,5-dimethoxy-6-methyloxan-2-yl]oxy-5-[(2R,3R,5S,6R)-6-hydroxy-3,5,6-trimethyloxan-2-yl]oxolan-2-yl]-5-methyloxolan-2-yl]-7-hydroxy-2,8-dimethyl-1,10-dioxaspiro[4.5]decan-9-yl]ethyl]-2,4-dihydroxy-5-methoxy-3-methyloxan-2-yl]acetic acid
| Internal ID | ef0ff6ca-65b6-41fa-8e16-051835a92174 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > O-glycosyl compounds |
| IUPAC Name | 2-[(2S,3R,4S,5S,6S)-6-[(1R)-1-[(2R,5S,7S,8R,9R)-2-[(2R,5R)-5-[(2R,3R,5R)-3-[(2S,4S,5S,6S)-4,5-dimethoxy-6-methyloxan-2-yl]oxy-5-[(2R,3R,5S,6R)-6-hydroxy-3,5,6-trimethyloxan-2-yl]oxolan-2-yl]-5-methyloxolan-2-yl]-7-hydroxy-2,8-dimethyl-1,10-dioxaspiro[4.5]decan-9-yl]ethyl]-2,4-dihydroxy-5-methoxy-3-methyloxan-2-yl]acetic acid |
| SMILES (Canonical) | CC1CC(C(OC1C2CC(C(O2)C3(CCC(O3)C4(CCC5(O4)CC(C(C(O5)C(C)C6C(C(C(C(O6)(CC(=O)O)O)C)O)OC)C)O)C)C)OC7CC(C(C(O7)C)OC)OC)(C)O)C |
| SMILES (Isomeric) | C[C@@H]1C[C@@H]([C@](O[C@H]1[C@H]2C[C@H]([C@@H](O2)[C@]3(CC[C@@H](O3)[C@]4(CC[C@]5(O4)C[C@@H]([C@H]([C@@H](O5)[C@@H](C)[C@H]6[C@H]([C@H]([C@H]([C@@](O6)(CC(=O)O)O)C)O)OC)C)O)C)C)O[C@H]7C[C@@H]([C@H]([C@@H](O7)C)OC)OC)(C)O)C |
| InChI | InChI=1S/C46H78O17/c1-22-17-23(2)44(9,51)60-36(22)30-18-31(57-34-19-29(53-10)39(54-11)27(6)56-34)41(58-30)43(8)14-13-32(59-43)42(7)15-16-45(63-42)20-28(47)24(3)37(61-45)25(4)38-40(55-12)35(50)26(5)46(52,62-38)21-33(48)49/h22-32,34-41,47,50-52H,13-21H2,1-12H3,(H,48,49)/t22-,23+,24-,25-,26-,27+,28+,29+,30-,31-,32-,34+,35+,36-,37-,38+,39+,40+,41-,42-,43-,44-,45+,46+/m1/s1 |
| InChI Key | YLJZFEIUUCJGFL-YFDOBUSLSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C46H78O17 |
| Molecular Weight | 903.10 g/mol |
| Exact Mass | 902.52390102 g/mol |
| Topological Polar Surface Area (TPSA) | 220.00 Ų |
| XlogP | 3.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL204 | P00734 | Thrombin | 99.67% | 96.01% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.44% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.86% | 85.14% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.73% | 90.17% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 96.71% | 96.77% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.25% | 94.45% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 92.24% | 97.14% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 91.18% | 91.19% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.04% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.57% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.78% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.51% | 97.09% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 88.42% | 97.28% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.31% | 95.89% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.16% | 89.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.65% | 92.62% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 86.60% | 91.03% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.49% | 99.23% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.20% | 92.50% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.49% | 96.95% |
| CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 83.06% | 97.43% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 82.87% | 96.61% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.66% | 95.89% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 82.43% | 85.31% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.91% | 89.50% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.80% | 99.15% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.13% | 100.00% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 80.11% | 97.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163051681 |
| LOTUS | LTS0113261 |
| wikiData | Q105350160 |