(18alpha)-Olean-12-en-3-one
Internal ID | 08383b47-3cea-44d6-96dd-7fbf4fc33588 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (4aR,6aR,6bS,8aR,12aS,14aR,14bR)-4,4,6a,6b,8a,11,11,14b-octamethyl-2,4a,5,6,7,8,9,10,12,12a,14,14a-dodecahydro-1H-picen-3-one |
SMILES (Canonical) | CC1(CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(=O)C5(C)C)C)C)C2C1)C)C)C |
SMILES (Isomeric) | C[C@@]12CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CCC(=O)C5(C)C)C)C)[C@H]1CC(CC2)(C)C)C |
InChI | InChI=1S/C30H48O/c1-25(2)15-16-27(5)17-18-29(7)20(21(27)19-25)9-10-23-28(6)13-12-24(31)26(3,4)22(28)11-14-30(23,29)8/h9,21-23H,10-19H2,1-8H3/t21-,22+,23-,27-,28+,29-,30-/m1/s1 |
InChI Key | LIIFBMGUDSHTOU-PKYVYUFTSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H48O |
Molecular Weight | 424.70 g/mol |
Exact Mass | 424.370516150 g/mol |
Topological Polar Surface Area (TPSA) | 17.10 Ų |
XlogP | 8.80 |
DTXSID401318882 |
118916-58-8 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.69% | 97.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.50% | 91.11% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 91.14% | 85.30% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.82% | 94.45% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 89.90% | 82.69% |
CHEMBL2581 | P07339 | Cathepsin D | 87.66% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.57% | 95.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.40% | 100.00% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 87.16% | 94.78% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.24% | 97.25% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.13% | 94.75% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 83.86% | 95.38% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.05% | 93.03% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.89% | 99.23% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.38% | 96.09% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 81.25% | 92.98% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.42% | 96.77% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.32% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Senecio crassissimus |
PubChem | 162966253 |
LOTUS | LTS0079301 |
wikiData | Q105152197 |