1,8a-dimethyl-7-prop-1-en-2-yl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene
| Internal ID | 42ac234a-ab3d-44f8-8908-48fbe7111f0b |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Eremophilane, 8,9-secoeremophilane and furoeremophilane sesquiterpenoids |
| IUPAC Name | 1,8a-dimethyl-7-prop-1-en-2-yl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene |
| SMILES (Canonical) | CC1CCCC2C1(CC(CC2)C(=C)C)C |
| SMILES (Isomeric) | CC1CCCC2C1(CC(CC2)C(=C)C)C |
| InChI | InChI=1S/C15H26/c1-11(2)13-8-9-14-7-5-6-12(3)15(14,4)10-13/h12-14H,1,5-10H2,2-4H3 |
| InChI Key | SMYOUERMLYFSON-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.203450829 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 6.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 93.46% | 92.94% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.03% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.03% | 91.11% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.34% | 82.69% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 91.10% | 91.49% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.96% | 96.09% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 88.90% | 98.10% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 86.77% | 97.64% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 86.25% | 97.05% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.77% | 97.09% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 83.62% | 95.38% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.11% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.16% | 95.89% |
| CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 82.15% | 98.99% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.79% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cineraria parvifolia |
| Frullania tamarisci |
| PubChem | 76005276 |
| LOTUS | LTS0206181 |
| wikiData | Q105286494 |