(2S,3S,4S,6S)-3-[(E,3R,5S)-5-hydroxy-1,7-bis(4-hydroxyphenyl)hept-1-en-3-yl]-2-(4-hydroxyphenyl)-6-[2-(4-hydroxyphenyl)ethyl]oxan-4-ol
Internal ID | f47fc974-879c-42cd-bf84-29951a319bba |
Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids |
IUPAC Name | (2S,3S,4S,6S)-3-[(E,3R,5S)-5-hydroxy-1,7-bis(4-hydroxyphenyl)hept-1-en-3-yl]-2-(4-hydroxyphenyl)-6-[2-(4-hydroxyphenyl)ethyl]oxan-4-ol |
SMILES (Canonical) | C1C(OC(C(C1O)C(CC(CCC2=CC=C(C=C2)O)O)C=CC3=CC=C(C=C3)O)C4=CC=C(C=C4)O)CCC5=CC=C(C=C5)O |
SMILES (Isomeric) | C1[C@@H](O[C@@H]([C@H]([C@H]1O)[C@H](C[C@H](CCC2=CC=C(C=C2)O)O)/C=C/C3=CC=C(C=C3)O)C4=CC=C(C=C4)O)CCC5=CC=C(C=C5)O |
InChI | InChI=1S/C38H42O7/c39-30-13-2-25(3-14-30)1-10-29(23-34(43)19-8-26-4-15-31(40)16-5-26)37-36(44)24-35(22-9-27-6-17-32(41)18-7-27)45-38(37)28-11-20-33(42)21-12-28/h1-7,10-18,20-21,29,34-44H,8-9,19,22-24H2/b10-1+/t29-,34-,35-,36-,37-,38+/m0/s1 |
InChI Key | OCGXHNIZNJTINO-VLSFOVKVSA-N |
Popularity | 0 references in papers |
Molecular Formula | C38H42O7 |
Molecular Weight | 610.70 g/mol |
Exact Mass | 610.29305367 g/mol |
Topological Polar Surface Area (TPSA) | 131.00 Ų |
XlogP | 6.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.21% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.87% | 91.49% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.50% | 97.09% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 96.88% | 97.64% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 94.69% | 98.35% |
CHEMBL233 | P35372 | Mu opioid receptor | 94.15% | 97.93% |
CHEMBL2581 | P07339 | Cathepsin D | 94.03% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.57% | 96.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 90.57% | 95.93% |
CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 90.30% | 100.00% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.02% | 93.99% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.85% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.70% | 95.89% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 87.46% | 94.62% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.12% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.98% | 94.73% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.33% | 94.45% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.13% | 95.89% |
CHEMBL236 | P41143 | Delta opioid receptor | 85.32% | 99.35% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.07% | 95.50% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.78% | 96.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.71% | 96.95% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.56% | 90.71% |
CHEMBL3038469 | P24941 | CDK2/Cyclin A | 82.94% | 91.38% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.42% | 97.25% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.09% | 89.00% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.86% | 85.00% |
CHEMBL301 | P24941 | Cyclin-dependent kinase 2 | 80.64% | 91.23% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.44% | 92.88% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Alpinia roxburghii |
PubChem | 163017223 |
LOTUS | LTS0233781 |
wikiData | Q105189360 |