5a-Hydroxy-10,11-dimethoxy-2,4a,5,7,8,13a,15,15a,15b,16-decahydro4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinolin-14-one
Internal ID | 184e50d8-ced5-4e65-869d-dde5f2cb9872 |
Taxonomy | Alkaloids and derivatives > Strychnos alkaloids |
IUPAC Name | 5a-hydroxy-10,11-dimethoxy-2,4a,5,7,8,13a,15,15a,15b,16-decahydro4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinolin-14-one |
SMILES (Canonical) | COC1=C(C=C2C(=C1)C34CCN5C3(CC6C7C4N2C(=O)CC7OCC=C6C5)O)OC |
SMILES (Isomeric) | COC1=C(C=C2C(=C1)C34CCN5C3(CC6C7C4N2C(=O)CC7OCC=C6C5)O)OC |
InChI | InChI=1S/C23H26N2O5/c1-28-16-7-14-15(8-17(16)29-2)25-19(26)9-18-20-13-10-23(27)22(14,21(20)25)4-5-24(23)11-12(13)3-6-30-18/h3,7-8,13,18,20-21,27H,4-6,9-11H2,1-2H3 |
InChI Key | JNNROFOMHXIAMQ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H26N2O5 |
Molecular Weight | 410.50 g/mol |
Exact Mass | 410.18417193 g/mol |
Topological Polar Surface Area (TPSA) | 71.50 Ų |
XlogP | 1.80 |
DTXSID80971385 |
NSC99794 |
NSC-99794 |
NCI60_042243 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.04% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.97% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.38% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.70% | 94.45% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.79% | 94.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 90.62% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.45% | 95.56% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 88.00% | 95.62% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.86% | 90.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.44% | 95.89% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.91% | 97.14% |
CHEMBL2581 | P07339 | Cathepsin D | 86.19% | 98.95% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 84.06% | 90.24% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.78% | 93.40% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.77% | 97.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.51% | 91.11% |
CHEMBL2535 | P11166 | Glucose transporter | 81.46% | 98.75% |
CHEMBL4829 | O00763 | Acetyl-CoA carboxylase 2 | 80.73% | 98.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Strychnos nux-vomica |
PubChem | 264628 |
LOTUS | LTS0212754 |
wikiData | Q82954883 |