8-(5,9-dihydroxy-7-methoxy-1,3-dimethyl-10-oxo-1,3,4,4a,5,10a-hexahydrobenzo[g]isochromen-8-yl)-9-hydroxy-7-methoxy-1,3-dimethyl-3,4,4a,10a-tetrahydro-1H-benzo[g]isochromene-5,10-dione
| Internal ID | 552afcdf-b5e5-4c39-8a03-333a554d06c8 |
| Taxonomy | Lignans, neolignans and related compounds |
| IUPAC Name | 8-(5,9-dihydroxy-7-methoxy-1,3-dimethyl-10-oxo-1,3,4,4a,5,10a-hexahydrobenzo[g]isochromen-8-yl)-9-hydroxy-7-methoxy-1,3-dimethyl-3,4,4a,10a-tetrahydro-1H-benzo[g]isochromene-5,10-dione |
| SMILES (Canonical) | CC1CC2C(C(O1)C)C(=O)C3=C(C(=C(C=C3C2O)OC)C4=C(C=C5C(=O)C6CC(OC(C6C(=O)C5=C4O)C)C)OC)O |
| SMILES (Isomeric) | CC1CC2C(C(O1)C)C(=O)C3=C(C(=C(C=C3C2O)OC)C4=C(C=C5C(=O)C6CC(OC(C6C(=O)C5=C4O)C)C)OC)O |
| InChI | InChI=1S/C32H36O10/c1-11-7-15-21(13(3)41-11)29(35)23-17(27(15)33)9-19(39-5)25(31(23)37)26-20(40-6)10-18-24(32(26)38)30(36)22-14(4)42-12(2)8-16(22)28(18)34/h9-16,21-22,27,33,37-38H,7-8H2,1-6H3 |
| InChI Key | SEFMRMJRLFTJBY-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C32H36O10 |
| Molecular Weight | 580.60 g/mol |
| Exact Mass | 580.23084734 g/mol |
| Topological Polar Surface Area (TPSA) | 149.00 Ų |
| XlogP | 3.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.48% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.97% | 96.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.54% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.13% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.77% | 86.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.07% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.84% | 98.95% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.83% | 92.94% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.17% | 90.71% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.92% | 97.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.91% | 99.23% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 86.56% | 97.21% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.15% | 94.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.97% | 90.00% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 84.68% | 94.42% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.92% | 99.17% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.16% | 95.89% |
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 83.16% | 98.46% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.28% | 96.95% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.65% | 99.15% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.55% | 96.21% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.67% | 89.50% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.55% | 89.62% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.54% | 86.92% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 85219829 |
| LOTUS | LTS0199063 |
| wikiData | Q104197212 |