[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (4aS,6aR,6bR,8aR,10R,12aR,14bS)-10-hydroxy-2,2,6b,9,9,12a,14b-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14-tetradecahydropicene-4a-carboxylate
| Internal ID | 106d6c87-c9ae-421e-a44f-e16a07b4670c |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Oxosteroids |
| IUPAC Name | [(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (4aS,6aR,6bR,8aR,10R,12aR,14bS)-10-hydroxy-2,2,6b,9,9,12a,14b-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14-tetradecahydropicene-4a-carboxylate |
| SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(OC(C(C2O)O)OCC3C(C(C(C(O3)OC(=O)C45CCC6=C(C4(CC(CC5)(C)C)C)CCC7C6(CCC8C7(CCC(C8(C)C)O)C)C)O)O)O)CO)O)O)O |
| SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)O[C@@H]2[C@H](O[C@H]([C@@H]([C@H]2O)O)OC[C@@H]3[C@H]([C@@H]([C@H]([C@@H](O3)OC(=O)[C@@]45CCC6=C([C@@]4(CC(CC5)(C)C)C)CC[C@H]7[C@]6(CC[C@@H]8[C@@]7(CC[C@H](C8(C)C)O)C)C)O)O)O)CO)O)O)O |
| InChI | InChI=1S/C48H78O17/c1-22-30(51)32(53)35(56)40(61-22)64-38-25(19-49)62-39(37(58)34(38)55)60-20-26-31(52)33(54)36(57)41(63-26)65-42(59)48-16-11-23-24(47(48,8)21-43(2,3)17-18-48)9-10-28-45(23,6)14-12-27-44(4,5)29(50)13-15-46(27,28)7/h22,25-41,49-58H,9-21H2,1-8H3/t22-,25+,26+,27-,28-,29+,30-,31+,32+,33-,34+,35+,36+,37+,38+,39+,40+,41-,45-,46-,47-,48-/m0/s1 |
| InChI Key | XIEWQGCDXOYOIW-XQOFKMJVSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C48H78O17 |
| Molecular Weight | 927.10 g/mol |
| Exact Mass | 926.52390102 g/mol |
| Topological Polar Surface Area (TPSA) | 275.00 Ų |
| XlogP | 1.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.99% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.40% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.87% | 97.09% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 90.88% | 97.36% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 90.79% | 95.93% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.56% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.44% | 89.00% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 90.02% | 93.04% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 87.97% | 95.50% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.76% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.40% | 86.33% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.23% | 100.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.84% | 95.89% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.12% | 97.25% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 83.92% | 98.10% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.24% | 92.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.97% | 95.89% |
| CHEMBL5028 | O14672 | ADAM10 | 82.83% | 97.50% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 80.98% | 92.32% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 80.67% | 89.67% |
| CHEMBL233 | P35372 | Mu opioid receptor | 80.36% | 97.93% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.34% | 94.33% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.34% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Heptapleurum bodinieri |
| PubChem | 163089956 |
| LOTUS | LTS0190045 |
| wikiData | Q105328438 |