18-hydroxy-14-O-methylgadesine
| Internal ID | 36c7c8ae-ab20-4de7-9207-960220c7e310 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Aconitane-type diterpenoid alkaloids |
| IUPAC Name | (1R,3R,5S,7S,10R,11S,12S,13R,14R,16S,17R,18S,19R)-4-ethyl-10-(hydroxymethyl)-12,16-dimethoxy-6-oxa-4-azaheptacyclo[15.2.1.02,7.02,11.03,13.05,10.014,19]icosane-13,14,18-triol |
| SMILES (Canonical) | CCN1C2C34C5CCC(C3C(C2(C6(CC(C7CC4C6C7O)OC)O)O)OC)(C1O5)CO |
| SMILES (Isomeric) | CCN1[C@H]2[C@]3([C@H]([C@H]4C2([C@@H]5CC[C@]4([C@@H]1O5)CO)[C@@H]6C[C@H]7[C@H](C[C@]3([C@H]6[C@H]7O)O)OC)OC)O |
| InChI | InChI=1S/C23H35NO7/c1-4-24-18-22-11-7-10-12(29-2)8-21(27,14(11)15(10)26)23(18,28)17(30-3)16(22)20(9-25)6-5-13(22)31-19(20)24/h10-19,25-28H,4-9H2,1-3H3/t10-,11+,12-,13-,14+,15-,16+,17-,18+,19-,20-,21+,22?,23-/m0/s1 |
| InChI Key | GMIJIHKENVWFFK-ASRZDHOVSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C23H35NO7 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.24135246 g/mol |
| Topological Polar Surface Area (TPSA) | 112.00 Ų |
| XlogP | -1.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.81% | 96.09% |
| CHEMBL204 | P00734 | Thrombin | 98.53% | 96.01% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.86% | 97.25% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 95.96% | 95.93% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.05% | 97.09% |
| CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 92.42% | 92.38% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.47% | 94.45% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 89.47% | 95.58% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 87.75% | 96.61% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.51% | 85.14% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.26% | 100.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.94% | 97.14% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 85.65% | 89.05% |
| CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 84.81% | 92.78% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.42% | 95.89% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.36% | 95.50% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.35% | 92.62% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 83.30% | 91.03% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 83.20% | 96.38% |
| CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 83.18% | 100.00% |
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 82.92% | 98.46% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 82.66% | 95.36% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.27% | 95.83% |
| CHEMBL3820 | P35557 | Hexokinase type IV | 82.21% | 91.96% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.92% | 86.33% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 81.85% | 95.38% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.63% | 96.77% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 81.13% | 97.50% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.12% | 92.94% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.56% | 91.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 129693803 |
| LOTUS | LTS0137242 |
| wikiData | Q105011861 |