(1,8-Dihydroxy-3-methylnaphthalen-2-yl) acetate
Internal ID | cfb5ff30-ea15-459e-aea9-9c36fe89990b |
Taxonomy | Benzenoids > Naphthalenes > Naphthols and derivatives |
IUPAC Name | (1,8-dihydroxy-3-methylnaphthalen-2-yl) acetate |
SMILES (Canonical) | CC1=CC2=C(C(=CC=C2)O)C(=C1OC(=O)C)O |
SMILES (Isomeric) | CC1=CC2=C(C(=CC=C2)O)C(=C1OC(=O)C)O |
InChI | InChI=1S/C13H12O4/c1-7-6-9-4-3-5-10(15)11(9)12(16)13(7)17-8(2)14/h3-6,15-16H,1-2H3 |
InChI Key | ZQMAYKOBQVTYTR-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C13H12O4 |
Molecular Weight | 232.23 g/mol |
Exact Mass | 232.07355886 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 3.10 |
There are no found synonyms. |
![2D Structure of (1,8-Dihydroxy-3-methylnaphthalen-2-yl) acetate 2D Structure of (1,8-Dihydroxy-3-methylnaphthalen-2-yl) acetate](https://plantaedb.com/storage/docs/compounds/2023/11/18-dihydroxy-3-methylnaphthalen-2-yl-acetate.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.44% | 91.11% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.80% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 92.82% | 98.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.15% | 99.15% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.78% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.18% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.10% | 86.33% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.24% | 96.95% |
CHEMBL3959 | P16083 | Quinone reductase 2 | 82.64% | 89.49% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.10% | 99.17% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.93% | 99.23% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.25% | 93.56% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 80.91% | 91.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.57% | 95.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.50% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dianella revoluta |
PubChem | 163027951 |
LOTUS | LTS0218862 |
wikiData | Q105381541 |