1,8-Dibromo-5,6-dichloro-2,6-dimethylocta-1,3,7-triene
| Internal ID | 6dcfb183-8af5-47fa-93d6-dfa973628563 |
| Taxonomy | Organohalogen compounds > Vinyl halides > Vinyl bromides |
| IUPAC Name | 1,8-dibromo-5,6-dichloro-2,6-dimethylocta-1,3,7-triene |
| SMILES (Canonical) | CC(=CBr)C=CC(C(C)(C=CBr)Cl)Cl |
| SMILES (Isomeric) | CC(=CBr)C=CC(C(C)(C=CBr)Cl)Cl |
| InChI | InChI=1S/C10H12Br2Cl2/c1-8(7-12)3-4-9(13)10(2,14)5-6-11/h3-7,9H,1-2H3 |
| InChI Key | UWZOIUBBJJHQJC-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C10H12Br2Cl2 |
| Molecular Weight | 362.91 g/mol |
| Exact Mass | 361.86623 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 4.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 88.21% | 89.34% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.36% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.14% | 97.25% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.29% | 94.73% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 82.68% | 92.29% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.29% | 96.09% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.58% | 96.77% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 73814992 |
| LOTUS | LTS0227251 |
| wikiData | Q105280644 |