3-[9-Butan-2-yl-6-(1,2-dihydroxyethyl)-39-hydroxy-3,31-bis(1-hydroxyethyl)-15,21-bis(1-hydroxy-2-methylpropyl)-10,18-dimethyl-34-(2-methylpropyl)-2,5,8,11,14,17,20,23,26,30,33,36-dodecaoxo-28-pentyl-24-propan-2-yl-1,4,7,10,13,16,19,22,25,29,32,35-dodecazabicyclo[35.3.0]tetracontan-12-yl]propanamide
| Internal ID | d14d07c2-aa91-416a-a2bd-3dcb5c01b2b2 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | 3-[9-butan-2-yl-6-(1,2-dihydroxyethyl)-39-hydroxy-3,31-bis(1-hydroxyethyl)-15,21-bis(1-hydroxy-2-methylpropyl)-10,18-dimethyl-34-(2-methylpropyl)-2,5,8,11,14,17,20,23,26,30,33,36-dodecaoxo-28-pentyl-24-propan-2-yl-1,4,7,10,13,16,19,22,25,29,32,35-dodecazabicyclo[35.3.0]tetracontan-12-yl]propanamide |
| SMILES (Canonical) | CCCCCC1CC(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)NC(C(=O)N2CC(CC2C(=O)NC(C(=O)NC(C(=O)N1)C(C)O)CC(C)C)O)C(C)O)C(CO)O)C(C)CC)C)CCC(=O)N)C(C(C)C)O)C)C(C(C)C)O)C(C)C |
| SMILES (Isomeric) | CCCCCC1CC(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)NC(C(=O)N2CC(CC2C(=O)NC(C(=O)NC(C(=O)N1)C(C)O)CC(C)C)O)C(C)O)C(CO)O)C(C)CC)C)CCC(=O)N)C(C(C)C)O)C)C(C(C)C)O)C(C)C |
| InChI | InChI=1S/C63H111N13O20/c1-16-18-19-20-36-24-43(83)69-44(29(5)6)56(89)74-48(51(84)30(7)8)59(92)65-33(12)53(86)73-49(52(85)31(9)10)60(93)67-38(21-22-42(64)82)62(95)75(15)50(32(11)17-2)61(94)72-47(41(81)27-77)58(91)71-46(35(14)79)63(96)76-26-37(80)25-40(76)55(88)68-39(23-28(3)4)54(87)70-45(34(13)78)57(90)66-36/h28-41,44-52,77-81,84-85H,16-27H2,1-15H3,(H2,64,82)(H,65,92)(H,66,90)(H,67,93)(H,68,88)(H,69,83)(H,70,87)(H,71,91)(H,72,94)(H,73,86)(H,74,89) |
| InChI Key | IEELHQHOEPWJSV-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C63H111N13O20 |
| Molecular Weight | 1370.60 g/mol |
| Exact Mass | 1369.80683298 g/mol |
| Topological Polar Surface Area (TPSA) | 516.00 Ų |
| XlogP | 1.40 |
| Atomic LogP (AlogP) | -5.21 |
| H-Bond Acceptor | 20 |
| H-Bond Donor | 18 |
| Rotatable Bonds | 20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.6638 | 66.38% |
| Caco-2 | - | 0.8595 | 85.95% |
| Blood Brain Barrier | - | 0.8250 | 82.50% |
| Human oral bioavailability | - | 0.7000 | 70.00% |
| Subcellular localzation | Lysosomes | 0.5405 | 54.05% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8056 | 80.56% |
| OATP1B3 inhibitior | + | 0.9078 | 90.78% |
| MATE1 inhibitior | - | 0.9812 | 98.12% |
| OCT2 inhibitior | - | 0.8750 | 87.50% |
| BSEP inhibitior | + | 0.9064 | 90.64% |
| P-glycoprotein inhibitior | + | 0.7409 | 74.09% |
| P-glycoprotein substrate | + | 0.8849 | 88.49% |
| CYP3A4 substrate | + | 0.7305 | 73.05% |
| CYP2C9 substrate | - | 0.6025 | 60.25% |
| CYP2D6 substrate | - | 0.8296 | 82.96% |
| CYP3A4 inhibition | - | 0.9336 | 93.36% |
| CYP2C9 inhibition | - | 0.8998 | 89.98% |
| CYP2C19 inhibition | - | 0.9181 | 91.81% |
| CYP2D6 inhibition | - | 0.9339 | 93.39% |
| CYP1A2 inhibition | - | 0.9397 | 93.97% |
| CYP2C8 inhibition | + | 0.7061 | 70.61% |
| CYP inhibitory promiscuity | - | 0.9961 | 99.61% |
| UGT catelyzed | + | 1.0000 | 100.00% |
| Carcinogenicity (binary) | - | 0.8100 | 81.00% |
| Carcinogenicity (trinary) | Non-required | 0.6037 | 60.37% |
| Eye corrosion | - | 0.9851 | 98.51% |
| Eye irritation | - | 0.8959 | 89.59% |
| Skin irritation | - | 0.7680 | 76.80% |
| Skin corrosion | - | 0.9001 | 90.01% |
| Ames mutagenesis | - | 0.5500 | 55.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6604 | 66.04% |
| Micronuclear | + | 0.7600 | 76.00% |
| Hepatotoxicity | - | 0.5088 | 50.88% |
| skin sensitisation | - | 0.8749 | 87.49% |
| Respiratory toxicity | + | 0.7333 | 73.33% |
| Reproductive toxicity | + | 0.8889 | 88.89% |
| Mitochondrial toxicity | + | 0.7750 | 77.50% |
| Nephrotoxicity | - | 0.7446 | 74.46% |
| Acute Oral Toxicity (c) | III | 0.6494 | 64.94% |
| Estrogen receptor binding | + | 0.7139 | 71.39% |
| Androgen receptor binding | + | 0.7197 | 71.97% |
| Thyroid receptor binding | + | 0.5923 | 59.23% |
| Glucocorticoid receptor binding | + | 0.7124 | 71.24% |
| Aromatase binding | + | 0.7142 | 71.42% |
| PPAR gamma | + | 0.7885 | 78.85% |
| Honey bee toxicity | - | 0.7175 | 71.75% |
| Biodegradation | - | 0.7250 | 72.50% |
| Crustacea aquatic toxicity | - | 0.5834 | 58.34% |
| Fish aquatic toxicity | - | 0.7373 | 73.73% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.82% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.53% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.28% | 97.25% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 97.85% | 98.03% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 97.31% | 97.29% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.64% | 97.09% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 95.16% | 97.79% |
| CHEMBL1949 | P62937 | Cyclophilin A | 94.74% | 98.57% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 94.54% | 91.81% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 94.53% | 82.69% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 94.49% | 95.00% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 94.04% | 100.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 92.97% | 96.47% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 92.91% | 97.64% |
| CHEMBL3045 | P05771 | Protein kinase C beta | 92.57% | 97.63% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 92.29% | 90.71% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 92.22% | 90.24% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.04% | 99.17% |
| CHEMBL228 | P31645 | Serotonin transporter | 91.96% | 95.51% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 91.94% | 90.08% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 91.73% | 82.38% |
| CHEMBL2443 | P49862 | Kallikrein 7 | 91.53% | 94.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 90.95% | 93.56% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 90.44% | 92.86% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.31% | 94.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.86% | 94.45% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 88.56% | 96.00% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 88.54% | 95.71% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 87.77% | 95.50% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 87.53% | 96.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.80% | 86.33% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.00% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.91% | 95.56% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 85.16% | 92.08% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.41% | 93.00% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 83.74% | 94.50% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 83.26% | 92.32% |
| CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 83.03% | 80.33% |
| CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 | 83.00% | 94.55% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.99% | 91.11% |
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 82.96% | 98.46% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 82.85% | 94.66% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 82.61% | 96.61% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 82.57% | 97.23% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.49% | 96.90% |
| CHEMBL4071 | P08311 | Cathepsin G | 82.33% | 94.64% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.64% | 95.89% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 81.44% | 96.37% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 80.86% | 100.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.53% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 85299175 |
| LOTUS | LTS0162659 |
| wikiData | Q105111727 |