1,7-Diphenyl-5-hydroxy-4,6-hepten-3-one
| Internal ID | dda8b44a-a8fd-4eb9-b3df-6443bb5cf676 |
| Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids |
| IUPAC Name | (4Z,6E)-5-hydroxy-1,7-diphenylhepta-4,6-dien-3-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C19H18O2/c20-18(13-11-16-7-3-1-4-8-16)15-19(21)14-12-17-9-5-2-6-10-17/h1-11,13,15,20H,12,14H2/b13-11+,18-15- |
| InChI Key | MJCANANSGRMBIC-HHEXEYPASA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C19H18O2 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.130679813 g/mol |
| Topological Polar Surface Area (TPSA) | 37.30 Ų |
| XlogP | 4.60 |
| (4Z,6E)-5-Hydroxy-1,7-diphenylhepta-4,6-dien-3-one |
| 478313-96-1 |
| 87095-77-0 |
| orb1680383 |
| TN6361 |
| AKOS040763406 |
| FS-8278 |
| DA-69418 |
| 5-hydroxy-1,7-bisphenyl-4,6-dien-3-heptanone |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2039 | P27338 | Monoamine oxidase B | 95.49% | 92.51% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.47% | 86.33% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 88.83% | 94.62% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.22% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.81% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.78% | 96.09% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.57% | 96.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.64% | 95.50% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.03% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.63% | 99.17% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.66% | 90.17% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 83.13% | 96.25% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.96% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 126592759 |
| LOTUS | LTS0072124 |
| wikiData | Q105165343 |