1,7-Dihydroxy-10-methyl-9(10H)-acridinone
| Internal ID | f25a6e54-1acb-41c0-b25f-ec2d8fa406a7 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines > Acridines > Acridones |
| IUPAC Name | 1,7-dihydroxy-10-methylacridin-9-one |
| SMILES (Canonical) | CN1C2=C(C(=CC=C2)O)C(=O)C3=C1C=CC(=C3)O |
| SMILES (Isomeric) | CN1C2=C(C(=CC=C2)O)C(=O)C3=C1C=CC(=C3)O |
| InChI | InChI=1S/C14H11NO3/c1-15-10-6-5-8(16)7-9(10)14(18)13-11(15)3-2-4-12(13)17/h2-7,16-17H,1H3 |
| InChI Key | WCDLZUUUNWEJTA-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H11NO3 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.07389321 g/mol |
| Topological Polar Surface Area (TPSA) | 60.80 Ų |
| XlogP | 3.00 |
| 1,7-Dihydroxy-10-methyl-9(10H)-acridinone |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 98.01% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.82% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 94.89% | 91.49% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 94.83% | 93.99% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.24% | 89.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 91.17% | 94.75% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.26% | 85.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.80% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.39% | 96.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.08% | 99.23% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.71% | 98.75% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.42% | 94.73% |
| CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 84.66% | 100.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.64% | 99.15% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.42% | 94.00% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 81.53% | 93.40% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.18% | 93.65% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Boenninghausenia albiflora |
| PubChem | 13857934 |
| LOTUS | LTS0004125 |
| wikiData | Q105301310 |