1,7-Diazatetracyclo[7.7.1.02,7.013,17]heptadecan-16-one
| Internal ID | 469ace10-a9f3-47a9-a637-d18b1080db1f |
| Taxonomy | Organoheterocyclic compounds > Pyridopyrimidines |
| IUPAC Name | 1,7-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-16-one |
| SMILES (Canonical) | C1CCN2CC3CCCC4C3N(C2C1)C(=O)CC4 |
| SMILES (Isomeric) | C1CCN2CC3CCCC4C3N(C2C1)C(=O)CC4 |
| InChI | InChI=1S/C15H24N2O/c18-14-8-7-11-4-3-5-12-10-16-9-2-1-6-13(16)17(14)15(11)12/h11-13,15H,1-10H2 |
| InChI Key | XKOXVHSFQDMHOU-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.36 g/mol |
| Exact Mass | 248.188863393 g/mol |
| Topological Polar Surface Area (TPSA) | 23.60 Ų |
| XlogP | 2.20 |
| There are no found synonyms. |
![2D Structure of 1,7-Diazatetracyclo[7.7.1.02,7.013,17]heptadecan-16-one](https://plantaedb.com/storage/docs/compounds/2023/11/17-diazatetracyclo77102701317heptadecan-16-one.jpg "2D Structure of 1,7-Diazatetracyclo[7.7.1.02,7.013,17]heptadecan-16-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.90% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.59% | 98.95% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 92.40% | 91.76% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.00% | 95.56% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 87.88% | 93.04% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 87.86% | 94.78% |
| CHEMBL4608 | P33032 | Melanocortin receptor 5 | 87.60% | 97.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.66% | 97.09% |
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 83.78% | 98.46% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 82.28% | 90.24% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.27% | 90.71% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.02% | 95.89% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 81.92% | 95.34% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 81.66% | 98.33% |
| CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 81.43% | 91.43% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.42% | 92.50% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.14% | 96.09% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.84% | 93.03% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.41% | 100.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.12% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162852677 |
| LOTUS | LTS0217764 |
| wikiData | Q105329634 |