1,7-Bis(4-hydroxyphenyl)hepta-2,4,6-trien-1-one
Internal ID | a0a694c8-cb0a-4efa-9533-dc66fab2b2cc |
Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids |
IUPAC Name | 1,7-bis(4-hydroxyphenyl)hepta-2,4,6-trien-1-one |
SMILES (Canonical) | C1=CC(=CC=C1C=CC=CC=CC(=O)C2=CC=C(C=C2)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C=CC=CC=CC(=O)C2=CC=C(C=C2)O)O |
InChI | InChI=1S/C19H16O3/c20-17-11-7-15(8-12-17)5-3-1-2-4-6-19(22)16-9-13-18(21)14-10-16/h1-14,20-21H |
InChI Key | WRCGSWXFJPRBPO-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C19H16O3 |
Molecular Weight | 292.30 g/mol |
Exact Mass | 292.109944368 g/mol |
Topological Polar Surface Area (TPSA) | 57.50 Ų |
XlogP | 4.30 |
1,7-Bis(4-hydroxyphenyl)hepta-2,4,6-trien-1-one |
DTXSID50827244 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2039 | P27338 | Monoamine oxidase B | 97.87% | 92.51% |
CHEMBL3194 | P02766 | Transthyretin | 92.16% | 90.71% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.87% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.89% | 86.33% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 84.87% | 98.35% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.31% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.51% | 95.56% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 82.42% | 85.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.70% | 89.00% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.90% | 91.71% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.10% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Etlingera elatior |
PubChem | 71406643 |
LOTUS | LTS0056086 |
wikiData | Q105311163 |