1,7-Bis (4-hydroxyphenyl)-1,4,6-heptatrien-3-one
| Internal ID | c79df33d-e61f-4434-975d-de4ba1161f2e |
| Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids |
| IUPAC Name | 1,7-bis(4-hydroxyphenyl)hepta-1,4,6-trien-3-one |
| SMILES (Canonical) | C1=CC(=CC=C1C=CC=CC(=O)C=CC2=CC=C(C=C2)O)O |
| SMILES (Isomeric) | C1=CC(=CC=C1C=CC=CC(=O)C=CC2=CC=C(C=C2)O)O |
| InChI | InChI=1S/C19H16O3/c20-17(10-7-16-8-13-19(22)14-9-16)4-2-1-3-15-5-11-18(21)12-6-15/h1-14,21-22H |
| InChI Key | PALMCMYYFAHUGA-UHFFFAOYSA-N |
| Popularity | 9 references in papers |
| Molecular Formula | C19H16O3 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.109944368 g/mol |
| Topological Polar Surface Area (TPSA) | 57.50 Ų |
| XlogP | 4.00 |
| Q15633963 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.45% | 91.11% |
| CHEMBL3194 | P02766 | Transthyretin | 88.01% | 90.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.92% | 95.56% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 85.28% | 92.51% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.95% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.13% | 89.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.96% | 96.00% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 80.28% | 90.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Curcuma longa |
| Curcuma mangga |
| Curcuma zedoaria |
| Dioscorea oppositifolia |
| Etlingera elatior |
| PubChem | 71346280 |
| LOTUS | LTS0187231 |
| wikiData | Q105204600 |