23-Methoxy-5,7,18,20-tetraoxa-24-azahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1(24),2,4(8),9,11,13,15,17(21),22-nonaene
| Internal ID | be4445b2-c3cb-42ff-b9a7-ce8d4e4ee9ea |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines > Phenanthridines and derivatives |
| IUPAC Name | 23-methoxy-5,7,18,20-tetraoxa-24-azahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1(24),2,4(8),9,11,13,15,17(21),22-nonaene |
| SMILES (Canonical) | COC1=C2C(=C3C=CC4=CC5=C(C=C4C3=N1)OCO5)C=CC6=C2OCO6 |
| SMILES (Isomeric) | COC1=C2C(=C3C=CC4=CC5=C(C=C4C3=N1)OCO5)C=CC6=C2OCO6 |
| InChI | InChI=1S/C20H13NO5/c1-22-20-17-11(4-5-14-19(17)26-9-23-14)12-3-2-10-6-15-16(25-8-24-15)7-13(10)18(12)21-20/h2-7H,8-9H2,1H3 |
| InChI Key | YKFHPKQJKJQLCZ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H13NO5 |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.07937252 g/mol |
| Topological Polar Surface Area (TPSA) | 59.00 Ų |
| XlogP | 4.60 |
| There are no found synonyms. |
![2D Structure of 23-Methoxy-5,7,18,20-tetraoxa-24-azahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1(24),2,4(8),9,11,13,15,17(21),22-nonaene](https://plantaedb.com/storage/docs/compounds/2023/11/16dddec0-86f9-11ee-a2b1-4bfd37e70b98.jpg "2D Structure of 23-Methoxy-5,7,18,20-tetraoxa-24-azahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1(24),2,4(8),9,11,13,15,17(21),22-nonaene")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 98.37% | 85.30% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 98.35% | 96.77% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.73% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.90% | 91.11% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 92.36% | 80.96% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 92.14% | 92.62% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 91.57% | 94.80% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.27% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.99% | 86.33% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 87.06% | 97.36% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 86.46% | 91.49% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.84% | 93.99% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.40% | 96.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.38% | 95.56% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 82.79% | 82.67% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.62% | 98.75% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.57% | 96.09% |
| CHEMBL5543 | Q9Y463 | Dual specificity tyrosine-phosphorylation-regulated kinase 1B | 81.83% | 94.70% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 81.45% | 96.67% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 80.04% | 95.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Argemone mexicana |
| Corydalis paniculigera |
| PubChem | 14313845 |
| LOTUS | LTS0122239 |
| wikiData | Q104395291 |