(2R)-2-[(2S,3S,4S)-4-hydroxy-5-oxo-3-(3,4,5-trihydroxybenzoyl)oxyoxolan-2-yl]-2-(3,4,5-trihydroxybenzoyl)oxyacetic acid
Internal ID | b2e9a0e7-0eb5-405f-ab2f-bca02079bac4 |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Tetracarboxylic acids and derivatives |
IUPAC Name | (2R)-2-[(2S,3S,4S)-4-hydroxy-5-oxo-3-(3,4,5-trihydroxybenzoyl)oxyoxolan-2-yl]-2-(3,4,5-trihydroxybenzoyl)oxyacetic acid |
SMILES (Canonical) | C1=C(C=C(C(=C1O)O)O)C(=O)OC2C(C(=O)OC2C(C(=O)O)OC(=O)C3=CC(=C(C(=C3)O)O)O)O |
SMILES (Isomeric) | C1=C(C=C(C(=C1O)O)O)C(=O)O[C@H]2[C@@H](C(=O)O[C@@H]2[C@H](C(=O)O)OC(=O)C3=CC(=C(C(=C3)O)O)O)O |
InChI | InChI=1S/C20H16O15/c21-7-1-5(2-8(22)11(7)25)18(30)33-14-13(27)20(32)34-15(14)16(17(28)29)35-19(31)6-3-9(23)12(26)10(24)4-6/h1-4,13-16,21-27H,(H,28,29)/t13-,14-,15-,16+/m0/s1 |
InChI Key | DRESSPOLWVWPPB-YHUYYLMFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H16O15 |
Molecular Weight | 496.30 g/mol |
Exact Mass | 496.04891980 g/mol |
Topological Polar Surface Area (TPSA) | 258.00 Ų |
XlogP | 0.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.17% | 91.11% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 93.23% | 83.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.38% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 90.10% | 90.71% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.47% | 99.15% |
CHEMBL2581 | P07339 | Cathepsin D | 86.81% | 98.95% |
CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 86.49% | 97.53% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.92% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.50% | 95.56% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 84.61% | 95.64% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.50% | 89.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.73% | 99.23% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 82.67% | 81.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Phyllanthus emblica |
PubChem | 162986714 |
LOTUS | LTS0140055 |
wikiData | Q104987357 |