(1R,2S,5S,6S,9R,10S,11R,13S)-11-hydroxy-2,6,10-trimethyl-8,14-dioxatetracyclo[8.4.0.01,13.05,9]tetradecan-7-one
| Internal ID | 078b7854-e5b2-4701-9dd2-dafee1f8700a |
| Taxonomy | Organoheterocyclic compounds > Oxanes |
| IUPAC Name | (1R,2S,5S,6S,9R,10S,11R,13S)-11-hydroxy-2,6,10-trimethyl-8,14-dioxatetracyclo[8.4.0.01,13.05,9]tetradecan-7-one |
| SMILES (Canonical) | CC1CCC2C(C(=O)OC2C3(C14C(O4)CC3O)C)C |
| SMILES (Isomeric) | C[C@H]1CC[C@H]2[C@@H](C(=O)O[C@H]2[C@]3([C@@]14[C@@H](O4)C[C@H]3O)C)C |
| InChI | InChI=1S/C15H22O4/c1-7-4-5-9-8(2)13(17)18-12(9)14(3)10(16)6-11-15(7,14)19-11/h7-12,16H,4-6H2,1-3H3/t7-,8-,9-,10+,11-,12+,14-,15-/m0/s1 |
| InChI Key | TZWAFSAXUHHSKV-BFABLCNSSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.15180918 g/mol |
| Topological Polar Surface Area (TPSA) | 59.10 Ų |
| XlogP | 1.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.29% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.06% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.96% | 97.09% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 86.69% | 93.04% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.49% | 95.56% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.38% | 97.25% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.71% | 85.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.31% | 89.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.21% | 100.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.23% | 99.23% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.27% | 94.75% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 80.24% | 96.61% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 80.19% | 97.05% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Parthenium hysterophorus |
| PubChem | 102407898 |
| LOTUS | LTS0054018 |
| wikiData | Q105268447 |