1,6-Phenazinedimethanol
| Internal ID | 5715fdc0-4077-4f13-ac52-389b2d8c045e |
| Taxonomy | Organoheterocyclic compounds > Diazanaphthalenes > Benzodiazines > Quinoxalines > Phenazines and derivatives |
| IUPAC Name | [6-(hydroxymethyl)phenazin-1-yl]methanol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C14H12N2O2/c17-7-9-3-1-5-11-13(9)16-12-6-2-4-10(8-18)14(12)15-11/h1-6,17-18H,7-8H2 |
| InChI Key | WFYLTIMBLPIRRU-UHFFFAOYSA-N |
| Popularity | 9 references in papers |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.089877630 g/mol |
| Topological Polar Surface Area (TPSA) | 66.20 Ų |
| XlogP | 0.90 |
| [6-(hydroxymethyl)phenazin-1-yl]methanol |
| (6-(hydroxymethyl)phenazin-1-yl)methanol |
| RefChem:73646 |
| 1,6-phenazine-dimethanol |
| SCHEMBL16431514 |
| CHEBI:198968 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.59% | 91.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.22% | 94.73% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 88.62% | 95.93% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.03% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.45% | 96.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.70% | 93.99% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.72% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.65% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.01% | 94.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.53% | 94.75% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.43% | 99.23% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 80.42% | 93.81% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 44607162 |
| LOTUS | LTS0133218 |
| wikiData | Q75063936 |