16-Methoxy-5-oxa-10-azatetracyclo[8.7.0.01,13.02,7]heptadeca-2(7),12,14-triene-4,11-dione
| Internal ID | e43f15e5-598b-4d58-8cf8-f8d0523c21eb |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives |
| IUPAC Name | 16-methoxy-5-oxa-10-azatetracyclo[8.7.0.01,13.02,7]heptadeca-2(7),12,14-triene-4,11-dione |
| SMILES (Canonical) | COC1CC23C4=C(CCN2C(=O)C=C3C=C1)COC(=O)C4 |
| SMILES (Isomeric) | COC1CC23C4=C(CCN2C(=O)C=C3C=C1)COC(=O)C4 |
| InChI | InChI=1S/C16H17NO4/c1-20-12-3-2-11-6-14(18)17-5-4-10-9-21-15(19)7-13(10)16(11,17)8-12/h2-3,6,12H,4-5,7-9H2,1H3 |
| InChI Key | CVLPRJMKSSUYQJ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.11575802 g/mol |
| Topological Polar Surface Area (TPSA) | 55.80 Ų |
| XlogP | -0.80 |
| There are no found synonyms. |
![2D Structure of 16-Methoxy-5-oxa-10-azatetracyclo[8.7.0.01,13.02,7]heptadeca-2(7),12,14-triene-4,11-dione](https://plantaedb.com/storage/docs/compounds/2023/11/16-methoxy-5-oxa-10-azatetracyclo8700113027heptadeca-271214-triene-411-dione.jpg "2D Structure of 16-Methoxy-5-oxa-10-azatetracyclo[8.7.0.01,13.02,7]heptadeca-2(7),12,14-triene-4,11-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.67% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.57% | 94.45% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.22% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.04% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.98% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.48% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.34% | 97.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.44% | 100.00% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 86.42% | 96.77% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.97% | 99.23% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.94% | 95.89% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.92% | 97.14% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.83% | 94.00% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 80.77% | 94.66% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.35% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Erythrina berteroana |
| PubChem | 73823607 |
| LOTUS | LTS0054424 |
| wikiData | Q104970861 |