1,6-Dimethyl-4-propan-2-yl-1,2,4a,7,8,8a-hexahydronaphthalene
Internal ID | a909d171-cbe8-439e-9e71-5cfda6939b56 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | 1,6-dimethyl-4-propan-2-yl-1,2,4a,7,8,8a-hexahydronaphthalene |
SMILES (Canonical) | CC1CC=C(C2C1CCC(=C2)C)C(C)C |
SMILES (Isomeric) | CC1CC=C(C2C1CCC(=C2)C)C(C)C |
InChI | InChI=1S/C15H24/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h8-10,12,14-15H,5-7H2,1-4H3 |
InChI Key | XPWZPBXGUQTUGP-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H24 |
Molecular Weight | 204.35 g/mol |
Exact Mass | 204.187800766 g/mol |
Topological Polar Surface Area (TPSA) | 0.00 Ų |
XlogP | 4.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 88.90% | 97.23% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.08% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.97% | 97.25% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 87.80% | 86.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.21% | 93.56% |
CHEMBL2581 | P07339 | Cathepsin D | 86.13% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.33% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.33% | 95.56% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 84.79% | 94.80% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 83.66% | 93.40% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.24% | 97.09% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.30% | 96.47% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.16% | 100.00% |
CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 80.74% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Otoba novogranatensis |
PubChem | 129659306 |
LOTUS | LTS0181163 |
wikiData | Q105339036 |