1,6-dimethoxy-3-methyl-9H-carbazole
| Internal ID | 7745e6ae-d859-4eda-a0ed-ddced55a36e2 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | 1,6-dimethoxy-3-methyl-9H-carbazole |
| SMILES (Canonical) | CC1=CC2=C(C(=C1)OC)NC3=C2C=C(C=C3)OC |
| SMILES (Isomeric) | CC1=CC2=C(C(=C1)OC)NC3=C2C=C(C=C3)OC |
| InChI | InChI=1S/C15H15NO2/c1-9-6-12-11-8-10(17-2)4-5-13(11)16-15(12)14(7-9)18-3/h4-8,16H,1-3H3 |
| InChI Key | LJVAJOOKSNRHMO-UHFFFAOYSA-N |
| Popularity | 9 references in papers |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.110278721 g/mol |
| Topological Polar Surface Area (TPSA) | 34.20 Ų |
| XlogP | 3.70 |
| Clausenine |
| CHEMBL4062014 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.52% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.48% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.11% | 95.56% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 93.00% | 93.31% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.91% | 94.45% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.43% | 94.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.95% | 98.75% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.65% | 92.94% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 86.00% | 85.49% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.56% | 93.99% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 85.05% | 95.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.98% | 90.00% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.57% | 91.71% |
| CHEMBL5979 | P05186 | Alkaline phosphatase, tissue-nonspecific isozyme | 83.38% | 85.40% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 83.28% | 93.24% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 81.34% | 98.59% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.21% | 96.00% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 80.28% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Clausena anisata |
| PubChem | 10354321 |
| LOTUS | LTS0199114 |
| wikiData | Q105152832 |