16-Chlorohexadeca-13,15-dien-9,11-diyn-3-ol
| Internal ID | f412e121-bb70-4e56-a1da-063891610e34 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Alcohols and polyols > Secondary alcohols |
| IUPAC Name | 16-chlorohexadeca-13,15-dien-9,11-diyn-3-ol |
| SMILES (Canonical) | CCC(CCCCCC#CC#CC=CC=CCl)O |
| SMILES (Isomeric) | CCC(CCCCCC#CC#CC=CC=CCl)O |
| InChI | InChI=1S/C16H21ClO/c1-2-16(18)14-12-10-8-6-4-3-5-7-9-11-13-15-17/h9,11,13,15-16,18H,2,6,8,10,12,14H2,1H3 |
| InChI Key | SSHSSJUSRDYXMD-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H21ClO |
| Molecular Weight | 264.79 g/mol |
| Exact Mass | 264.1280930 g/mol |
| Topological Polar Surface Area (TPSA) | 20.20 Ų |
| XlogP | 5.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 96.68% | 92.86% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.63% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.06% | 90.17% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 90.28% | 98.75% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 90.25% | 89.34% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.76% | 98.95% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 87.03% | 85.94% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 86.52% | 97.29% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.11% | 99.17% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 85.73% | 97.47% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 85.09% | 87.45% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.13% | 92.88% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.02% | 94.45% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 81.44% | 98.35% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.02% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 73814481 |
| LOTUS | LTS0131626 |
| wikiData | Q105259664 |