1,6-Bis(3,4-dimethoxyphenyl)-3,4-dimethylhexan-2-ol
| Internal ID | 0fa69d2c-ddcd-4517-8044-a85b8b7f6a5d |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Methoxybenzenes > Dimethoxybenzenes |
| IUPAC Name | 1,6-bis(3,4-dimethoxyphenyl)-3,4-dimethylhexan-2-ol |
| SMILES (Canonical) | CC(CCC1=CC(=C(C=C1)OC)OC)C(C)C(CC2=CC(=C(C=C2)OC)OC)O |
| SMILES (Isomeric) | CC(CCC1=CC(=C(C=C1)OC)OC)C(C)C(CC2=CC(=C(C=C2)OC)OC)O |
| InChI | InChI=1S/C24H34O5/c1-16(7-8-18-9-11-21(26-3)23(14-18)28-5)17(2)20(25)13-19-10-12-22(27-4)24(15-19)29-6/h9-12,14-17,20,25H,7-8,13H2,1-6H3 |
| InChI Key | MXBCUUKBWQLFOZ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.24062418 g/mol |
| Topological Polar Surface Area (TPSA) | 57.20 Ų |
| XlogP | 5.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.76% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.09% | 98.95% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 94.39% | 90.20% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.16% | 98.75% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.45% | 99.17% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.87% | 85.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.38% | 86.33% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.30% | 95.50% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 85.70% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.49% | 95.89% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 84.42% | 95.17% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 83.61% | 92.68% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.55% | 94.45% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.11% | 90.71% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.57% | 96.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.46% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Virola peruviana |
| PubChem | 163055511 |
| LOTUS | LTS0200040 |
| wikiData | Q105173960 |