5-Hydroxy-5',7-dimethyl-3-methylidenespiro[3a,4,5,7,8,8a-hexahydrocyclohepta[b]furan-6,2'-oxolane]-2-one
| Internal ID | 7984d30d-7577-41f5-960a-e873ad89ed25 |
| Taxonomy | Organoheterocyclic compounds > Lactones > Gamma butyrolactones |
| IUPAC Name | 5-hydroxy-5',7-dimethyl-3-methylidenespiro[3a,4,5,7,8,8a-hexahydrocyclohepta[b]furan-6,2'-oxolane]-2-one |
| SMILES (Canonical) | CC1CCC2(O1)C(CC3C(CC2O)C(=C)C(=O)O3)C |
| SMILES (Isomeric) | CC1CCC2(O1)C(CC3C(CC2O)C(=C)C(=O)O3)C |
| InChI | InChI=1S/C15H22O4/c1-8-6-12-11(10(3)14(17)18-12)7-13(16)15(8)5-4-9(2)19-15/h8-9,11-13,16H,3-7H2,1-2H3 |
| InChI Key | ZHGHWBHFNAIEDW-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.15180918 g/mol |
| Topological Polar Surface Area (TPSA) | 55.80 Ų |
| XlogP | 1.90 |
| There are no found synonyms. |
![2D Structure of 5-Hydroxy-5',7-dimethyl-3-methylidenespiro[3a,4,5,7,8,8a-hexahydrocyclohepta[b]furan-6,2'-oxolane]-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/15f28bd0-875f-11ee-a42d-c702de21fc42.jpg "2D Structure of 5-Hydroxy-5',7-dimethyl-3-methylidenespiro[3a,4,5,7,8,8a-hexahydrocyclohepta[b]furan-6,2'-oxolane]-2-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.63% | 97.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.66% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.25% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.24% | 95.56% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 86.22% | 96.61% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.78% | 97.25% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 84.83% | 93.03% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 84.32% | 98.03% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.24% | 100.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.93% | 99.23% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 83.91% | 93.04% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 80.51% | 97.79% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.43% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Carpesium longifolium |
| PubChem | 78200914 |
| LOTUS | LTS0125205 |
| wikiData | Q105375718 |