(2R,3S,4S,5S,6R)-2-[(2R,3R,4S,5S,6R)-5-hydroxy-6-(hydroxymethyl)-2-[[(1S,2S,7S,10R,11S,14S,15R,16S,17S,20S,23S)-10,14,16,20-tetramethyl-22-azahexacyclo[12.10.0.02,11.05,10.015,23.017,22]tetracos-4-en-7-yl]oxy]-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | 9b3504d6-393d-413c-88a8-12c6540dd60d |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (2R,3S,4S,5S,6R)-2-[(2R,3R,4S,5S,6R)-5-hydroxy-6-(hydroxymethyl)-2-[[(1S,2S,7S,10R,11S,14S,15R,16S,17S,20S,23S)-10,14,16,20-tetramethyl-22-azahexacyclo[12.10.0.02,11.05,10.015,23.017,22]tetracos-4-en-7-yl]oxy]-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1CCC2C(C3C(N2C1)CC4C3(CCC5C4CC=C6C5(CCC(C6)OC7C(C(C(C(O7)CO)O)OC8C(C(C(C(O8)CO)O)O)O)OC9C(C(C(C(O9)C)O)O)O)C)C)C |
SMILES (Isomeric) | C[C@H]1CC[C@H]2[C@H]([C@H]3[C@@H](N2C1)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC=C6[C@@]5(CC[C@@H](C6)O[C@H]7[C@@H]([C@H]([C@H]([C@H](O7)CO)O)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)O[C@@H]9[C@H]([C@H]([C@@H]([C@H](O9)C)O)O)O)C)C)C |
InChI | InChI=1S/C45H73NO15/c1-19-6-9-27-20(2)31-28(46(27)16-19)15-26-24-8-7-22-14-23(10-12-44(22,4)25(24)11-13-45(26,31)5)57-43-40(61-41-37(54)35(52)32(49)21(3)56-41)39(34(51)30(18-48)59-43)60-42-38(55)36(53)33(50)29(17-47)58-42/h7,19-21,23-43,47-55H,6,8-18H2,1-5H3/t19-,20+,21+,23-,24+,25-,26-,27-,28-,29+,30+,31-,32+,33+,34-,35-,36-,37-,38+,39-,40+,41+,42-,43+,44-,45-/m0/s1 |
InChI Key | ZGVSETXHNHBTRK-SMQJHKSSSA-N |
Popularity | 0 references in papers |
Molecular Formula | C45H73NO15 |
Molecular Weight | 868.10 g/mol |
Exact Mass | 867.49802062 g/mol |
Topological Polar Surface Area (TPSA) | 241.00 Ų |
XlogP | 1.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.18% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.44% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 96.87% | 95.93% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 94.95% | 89.05% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.54% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.39% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.03% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 92.29% | 98.95% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.43% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.76% | 89.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.04% | 95.89% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 87.23% | 98.46% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.07% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.73% | 94.45% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.21% | 92.50% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 83.23% | 97.36% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.74% | 93.56% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.60% | 96.90% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.28% | 94.00% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 81.08% | 86.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.19% | 92.94% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.05% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum dasyphyllum |
Solanum nigrum |
Solanum stoloniferum |
Solanum tuberosum |
PubChem | 134784057 |
LOTUS | LTS0165685 |
wikiData | Q104391983 |