[13-(Furan-3-yl)-7-hydroxy-6,6,10-trimethyl-15-oxo-2,14-dioxatricyclo[9.4.0.01,3]pentadecan-8-yl] 2-methylbut-2-enoate
Internal ID | d1cc31ba-9d07-4e54-aeb1-bedee429553c |
Taxonomy | Organoheterocyclic compounds > Lactones > Delta valerolactones |
IUPAC Name | [13-(furan-3-yl)-7-hydroxy-6,6,10-trimethyl-15-oxo-2,14-dioxatricyclo[9.4.0.01,3]pentadecan-8-yl] 2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1CC(C2CC(OC(=O)C23C(O3)CCC(C1O)(C)C)C4=COC=C4)C |
SMILES (Isomeric) | CC=C(C)C(=O)OC1CC(C2CC(OC(=O)C23C(O3)CCC(C1O)(C)C)C4=COC=C4)C |
InChI | InChI=1S/C25H34O7/c1-6-14(2)22(27)30-19-11-15(3)17-12-18(16-8-10-29-13-16)31-23(28)25(17)20(32-25)7-9-24(4,5)21(19)26/h6,8,10,13,15,17-21,26H,7,9,11-12H2,1-5H3 |
InChI Key | NEPDHJLHSDTJJL-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H34O7 |
Molecular Weight | 446.50 g/mol |
Exact Mass | 446.23045342 g/mol |
Topological Polar Surface Area (TPSA) | 98.50 Ų |
XlogP | 4.00 |
There are no found synonyms. |
![2D Structure of [13-(Furan-3-yl)-7-hydroxy-6,6,10-trimethyl-15-oxo-2,14-dioxatricyclo[9.4.0.01,3]pentadecan-8-yl] 2-methylbut-2-enoate 2D Structure of [13-(Furan-3-yl)-7-hydroxy-6,6,10-trimethyl-15-oxo-2,14-dioxatricyclo[9.4.0.01,3]pentadecan-8-yl] 2-methylbut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/15a04cd0-8596-11ee-bd46-a108b5304ed1.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.51% | 91.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.54% | 90.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.24% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.94% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.44% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.38% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.65% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.32% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.77% | 99.23% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.27% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.88% | 91.19% |
CHEMBL2039 | P27338 | Monoamine oxidase B | 83.57% | 92.51% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.82% | 94.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.21% | 91.07% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.00% | 95.89% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 81.50% | 94.80% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.86% | 93.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.75% | 100.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.02% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Nidorella hottentotica |
PubChem | 162873409 |
LOTUS | LTS0121995 |
wikiData | Q105178093 |