1,5,6-Trihydroxy-2,3-dimethoxy-10-methylacridin-9-one
Internal ID | aedfc585-f40c-46fd-9a19-7136df25fe24 |
Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines > Acridines > Acridones |
IUPAC Name | 1,5,6-trihydroxy-2,3-dimethoxy-10-methylacridin-9-one |
SMILES (Canonical) | CN1C2=CC(=C(C(=C2C(=O)C3=C1C(=C(C=C3)O)O)O)OC)OC |
SMILES (Isomeric) | CN1C2=CC(=C(C(=C2C(=O)C3=C1C(=C(C=C3)O)O)O)OC)OC |
InChI | InChI=1S/C16H15NO6/c1-17-8-6-10(22-2)16(23-3)15(21)11(8)13(19)7-4-5-9(18)14(20)12(7)17/h4-6,18,20-21H,1-3H3 |
InChI Key | MBKAHECHLBGLLI-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C16H15NO6 |
Molecular Weight | 317.29 g/mol |
Exact Mass | 317.08993720 g/mol |
Topological Polar Surface Area (TPSA) | 99.50 Ų |
XlogP | 2.50 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.89% | 95.56% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 95.73% | 93.99% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.87% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 94.16% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.38% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.22% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.16% | 91.11% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 92.14% | 80.78% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 89.79% | 94.42% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.79% | 99.15% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.49% | 94.45% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 89.33% | 89.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.83% | 86.33% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 86.58% | 91.49% |
CHEMBL2535 | P11166 | Glucose transporter | 84.20% | 98.75% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 84.03% | 98.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.49% | 85.14% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.04% | 94.75% |
CHEMBL3132741 | P55201 | Peregrin | 81.44% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.83% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Pleiospermium alatum |
PubChem | 14463130 |
LOTUS | LTS0076231 |
wikiData | Q105160818 |