2-[3-[(2R,4S,5R,6R)-4,5-dihydroxy-6-methyloxan-2-yl]oxy-4-hydroxyphenyl]-5-hydroxy-7-methoxy-3-[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxychromen-4-one
Internal ID | ae065610-f334-4406-8b77-73aa8fa9ac71 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | 2-[3-[(2R,4S,5R,6R)-4,5-dihydroxy-6-methyloxan-2-yl]oxy-4-hydroxyphenyl]-5-hydroxy-7-methoxy-3-[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | CC1C(C(CC(O1)OC2=C(C=CC(=C2)C3=C(C(=O)C4=C(C=C(C=C4O3)OC)O)OC5C(C(C(CO5)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@@H]1[C@@H]([C@H](C[C@H](O1)OC2=C(C=CC(=C2)C3=C(C(=O)C4=C(C=C(C=C4O3)OC)O)O[C@@H]5[C@@H]([C@H]([C@H](CO5)O)O)O)O)O)O |
InChI | InChI=1S/C27H30O14/c1-10-21(32)15(30)8-19(38-10)39-17-5-11(3-4-13(17)28)25-26(41-27-24(35)22(33)16(31)9-37-27)23(34)20-14(29)6-12(36-2)7-18(20)40-25/h3-7,10,15-16,19,21-22,24,27-33,35H,8-9H2,1-2H3/t10-,15+,16+,19-,21+,22+,24-,27-/m1/s1 |
InChI Key | IRRZKTAIXOHIKH-ZTTXCHEFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H30O14 |
Molecular Weight | 578.50 g/mol |
Exact Mass | 578.16355563 g/mol |
Topological Polar Surface Area (TPSA) | 214.00 Ų |
XlogP | 0.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.01% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.12% | 85.14% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.61% | 91.49% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.39% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.33% | 89.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 95.88% | 99.15% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.44% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.16% | 97.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 91.54% | 90.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.45% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.98% | 86.33% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 90.11% | 90.71% |
CHEMBL2581 | P07339 | Cathepsin D | 89.65% | 98.95% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 88.04% | 95.53% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 87.59% | 95.78% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.04% | 99.17% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.38% | 97.14% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.85% | 99.23% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.61% | 94.45% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.56% | 92.94% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.60% | 95.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.50% | 95.89% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 80.48% | 97.33% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.34% | 96.77% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Peumus boldus |
PubChem | 162884790 |
LOTUS | LTS0066539 |
wikiData | Q105119075 |