N-[6-[3-[5-[4,5-dihydroxy-6-methyl-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-16-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-5-oxoheptyl]acetamide
Internal ID | 605728cc-4436-48d1-9399-c6a7a7b49a6d |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | N-[6-[3-[5-[4,5-dihydroxy-6-methyl-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-16-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-5-oxoheptyl]acetamide |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3CCC4(C(C3)CCC5C4CCC6(C5CC(C6C(C)C(=O)CCC(C)CNC(=O)C)O)C)C)CO)OC7C(C(C(CO7)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3CCC4(C(C3)CCC5C4CCC6(C5CC(C6C(C)C(=O)CCC(C)CNC(=O)C)O)C)C)CO)OC7C(C(C(CO7)O)O)O)O)O |
InChI | InChI=1S/C46H77NO17/c1-20(17-47-23(4)49)7-10-29(50)21(2)33-30(51)16-28-26-9-8-24-15-25(11-13-45(24,5)27(26)12-14-46(28,33)6)61-43-39(58)37(56)40(32(18-48)62-43)63-44-41(36(55)34(53)22(3)60-44)64-42-38(57)35(54)31(52)19-59-42/h20-22,24-28,30-44,48,51-58H,7-19H2,1-6H3,(H,47,49) |
InChI Key | MTFMWINXJJVOSD-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C46H77NO17 |
Molecular Weight | 916.10 g/mol |
Exact Mass | 915.51914999 g/mol |
Topological Polar Surface Area (TPSA) | 284.00 Ų |
XlogP | 0.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.61% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.49% | 91.11% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 97.84% | 95.58% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 96.92% | 96.38% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 96.44% | 95.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.93% | 97.09% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 93.17% | 98.05% |
CHEMBL2581 | P07339 | Cathepsin D | 92.99% | 98.95% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 92.83% | 96.77% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.66% | 94.45% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 92.20% | 96.21% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 91.66% | 95.93% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.36% | 97.25% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 91.24% | 91.19% |
CHEMBL237 | P41145 | Kappa opioid receptor | 90.29% | 98.10% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.40% | 89.00% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 89.36% | 96.61% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 88.87% | 97.29% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 88.32% | 95.71% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 88.17% | 95.36% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.04% | 95.89% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 87.95% | 97.50% |
CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 86.51% | 96.28% |
CHEMBL5028 | O14672 | ADAM10 | 86.24% | 97.50% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.01% | 92.50% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.93% | 100.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.57% | 100.00% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 84.92% | 97.86% |
CHEMBL233 | P35372 | Mu opioid receptor | 84.47% | 97.93% |
CHEMBL204 | P00734 | Thrombin | 84.26% | 96.01% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 83.70% | 82.50% |
CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 83.35% | 99.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.31% | 94.33% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.10% | 95.50% |
CHEMBL299 | P17252 | Protein kinase C alpha | 82.91% | 98.03% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.84% | 90.71% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 82.56% | 91.24% |
CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 82.07% | 96.33% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.91% | 96.90% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 81.45% | 98.75% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 81.03% | 100.00% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.94% | 95.83% |
CHEMBL202 | P00374 | Dihydrofolate reductase | 80.76% | 89.92% |
CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 80.05% | 96.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum abutiloides |
PubChem | 75094465 |
LOTUS | LTS0233087 |
wikiData | Q105171667 |