1,5,11-Trimethyl-8-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-2,6,10-trien-5-ol
| Internal ID | 0beeeb89-f106-4be3-8a13-1be00387f266 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | 1,5,11-trimethyl-8-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-2,6,10-trien-5-ol |
| SMILES (Canonical) | CC1=CCC(C=CC(CC=CC2(CCC1O2)C)(C)O)C(C)C |
| SMILES (Isomeric) | CC1=CCC(C=CC(CC=CC2(CCC1O2)C)(C)O)C(C)C |
| InChI | InChI=1S/C20H32O2/c1-15(2)17-8-7-16(3)18-10-14-20(5,22-18)12-6-11-19(4,21)13-9-17/h6-7,9,12-13,15,17-18,21H,8,10-11,14H2,1-5H3 |
| InChI Key | LXTMIBQQMKEULI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.240230259 g/mol |
| Topological Polar Surface Area (TPSA) | 29.50 Ų |
| XlogP | 3.90 |
| There are no found synonyms. |
![2D Structure of 1,5,11-Trimethyl-8-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-2,6,10-trien-5-ol](https://plantaedb.com/storage/docs/compounds/2023/11/1511-trimethyl-8-propan-2-yl-15-oxabicyclo1021pentadeca-2610-trien-5-ol.jpg "2D Structure of 1,5,11-Trimethyl-8-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-2,6,10-trien-5-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.08% | 91.11% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 95.92% | 96.61% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.62% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.47% | 96.09% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.92% | 93.56% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.82% | 94.75% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.26% | 85.14% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.59% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.57% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.68% | 95.56% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 86.30% | 96.77% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.62% | 95.89% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.96% | 94.45% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.93% | 89.00% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 82.77% | 97.79% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.04% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Nicotiana tabacum |
| PubChem | 163023414 |
| LOTUS | LTS0040819 |
| wikiData | Q105159074 |