15-O-Butyllatrunculin B
| Internal ID | 5d606405-b6eb-4ba3-89cc-275fd1701431 |
| Taxonomy | Phenylpropanoids and polyketides > Macrolides and analogues |
| IUPAC Name | (4R)-4-[(1R,4Z,8Z,10S,13R,15R)-15-butoxy-5,10-dimethyl-3-oxo-2,14-dioxabicyclo[11.3.1]heptadeca-4,8-dien-15-yl]-1,3-thiazolidin-2-one |
| SMILES (Canonical) | CCCCOC1(CC2CC(O1)CCC(C=CCCC(=CC(=O)O2)C)C)C3CSC(=O)N3 |
| SMILES (Isomeric) | CCCCO[C@@]1(C[C@H]2C[C@H](O1)CC[C@@H](/C=C\CC/C(=C\C(=O)O2)/C)C)[C@@H]3CSC(=O)N3 |
| InChI | InChI=1S/C24H37NO5S/c1-4-5-12-28-24(21-16-31-23(27)25-21)15-20-14-19(30-24)11-10-17(2)8-6-7-9-18(3)13-22(26)29-20/h6,8,13,17,19-21H,4-5,7,9-12,14-16H2,1-3H3,(H,25,27)/b8-6-,18-13-/t17-,19-,20-,21+,24-/m1/s1 |
| InChI Key | FLXXYAPFRVVUIF-LOJUFBAJSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C24H37NO5S |
| Molecular Weight | 451.60 g/mol |
| Exact Mass | 451.23924445 g/mol |
| Topological Polar Surface Area (TPSA) | 99.20 Ų |
| XlogP | 4.70 |
| CHEMBL522801 |
| (4R)-4-[(1R,4S,5Z,9Z,13R,15R)-15-butoxy-4,9-dimethyl-11-oxo-12,16-dioxabicyclo[11.3.1]heptadeca-5,9-dien-15-yl]thiazolidin-2-one |
| 2-Thiazolidinone, 4-[(1R,4Z,8Z,10S,13R,15R)-15-butoxy-5,10-dimethyl-3-oxo-2,14-dioxabicyclo[11.3.1]heptadeca-4,8-dien-15-yl]-, (4R)- |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.32% | 97.25% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 97.19% | 89.63% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.52% | 97.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.07% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.30% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.27% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.18% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.89% | 99.23% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.75% | 94.73% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.55% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.33% | 95.89% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.13% | 95.50% |
| CHEMBL4072 | P07858 | Cathepsin B | 81.75% | 93.67% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.91% | 90.08% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.72% | 99.17% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 80.56% | 94.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.14% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 11683846 |
| LOTUS | LTS0074720 |
| wikiData | Q104997598 |