15-Hydroxygeldanamycin
| Internal ID | 3988b83e-0718-4815-af9b-d9afbc7d61c4 |
| Taxonomy | Organic acids and derivatives > Vinylogous esters |
| IUPAC Name | [(4Z,6Z,8S,9S,10Z,12S,13R,14S,16S,17R)-13,17-dihydroxy-8,14,19-trimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate |
| SMILES (Canonical) | CC1CC(C(C(C=C(C(C(C=CC=C(C(=O)NC2=CC(=O)C(=C(C1O)C2=O)OC)C)OC)OC(=O)N)C)C)O)OC |
| SMILES (Isomeric) | C[C@H]1C[C@@H]([C@@H]([C@H](/C=C(\[C@@H]([C@H](/C=C\C=C(/C(=O)NC2=CC(=O)C(=C([C@@H]1O)C2=O)OC)\C)OC)OC(=O)N)/C)C)O)OC |
| InChI | InChI=1S/C29H40N2O10/c1-14-9-8-10-20(38-5)26(41-29(30)37)17(4)11-15(2)23(33)21(39-6)12-16(3)24(34)22-25(35)18(31-28(14)36)13-19(32)27(22)40-7/h8-11,13,15-16,20-21,23-24,26,33-34H,12H2,1-7H3,(H2,30,37)(H,31,36)/b10-8-,14-9-,17-11-/t15-,16-,20-,21-,23+,24+,26-/m0/s1 |
| InChI Key | UCBVCEVBUMICFC-SCCFEFTKSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C29H40N2O10 |
| Molecular Weight | 576.60 g/mol |
| Exact Mass | 576.26829548 g/mol |
| Topological Polar Surface Area (TPSA) | 184.00 Ų |
| XlogP | 0.90 |
| [(4Z,6Z,8S,9S,10Z,12S,13R,14S,16S,17R)-13,17-dihydroxy-8,14,19-trimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate |
| (((4Z,6Z,8S,9S,10Z,12S,13R,14S,16S,17R)-3,13,17-trihydroxy-8,14,19-trimethoxy-4,10,12,16-tetramethyl-20,22-dioxo-2-azabicyclo(16.3.1)docosa-1(21),2,4,6,10,18-hexaen-9-yl)oxy)methanimidate |
| ((4Z,6Z,8S,9S,10Z,12S,13R,14S,16S,17R)-13,17-dihydroxy-8,14,19-trimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-2-azabicyclo(16.3.1)docosa-1(21),4,6,10,18-pentaen-9-yl) carbamate |
| {[(4Z,6Z,8S,9S,10Z,12S,13R,14S,16S,17R)-3,13,17-trihydroxy-8,14,19-trimethoxy-4,10,12,16-tetramethyl-20,22-dioxo-2-azabicyclo[16.3.1]docosa-1(21),2,4,6,10,18-hexaen-9-yl]oxy}methanimidate |
| RefChem:78822 |
| CHEBI:206701 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.75% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.63% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.36% | 91.11% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 95.88% | 96.77% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.67% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.10% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.89% | 97.09% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.60% | 92.94% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.96% | 99.23% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 89.46% | 93.03% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.16% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.02% | 98.95% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 86.40% | 91.07% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 85.36% | 95.71% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.92% | 96.95% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.07% | 91.19% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.17% | 98.75% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.92% | 95.89% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 81.92% | 96.47% |
| CHEMBL5028 | O14672 | ADAM10 | 80.66% | 97.50% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 80.30% | 97.33% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.07% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139585610 |
| LOTUS | LTS0161379 |
| wikiData | Q77483517 |