15-Hydroxy-17-methoxy-5-methyl-3,4-dioxabicyclo[11.4.0]heptadeca-1(13),11,14,16-tetraen-2-one
| Internal ID | 92b71f11-d29a-4222-a13c-40810e5b60c9 |
| Taxonomy | Benzenoids > Phenol ethers > Anisoles |
| IUPAC Name | 15-hydroxy-17-methoxy-5-methyl-3,4-dioxabicyclo[11.4.0]heptadeca-1(13),11,14,16-tetraen-2-one |
| SMILES (Canonical) | CC1CCCCCC=CC2=C(C(=CC(=C2)O)OC)C(=O)OO1 |
| SMILES (Isomeric) | CC1CCCCCC=CC2=C(C(=CC(=C2)O)OC)C(=O)OO1 |
| InChI | InChI=1S/C17H22O5/c1-12-8-6-4-3-5-7-9-13-10-14(18)11-15(20-2)16(13)17(19)22-21-12/h7,9-12,18H,3-6,8H2,1-2H3 |
| InChI Key | YEQAQFUAXUIKFB-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.14672380 g/mol |
| Topological Polar Surface Area (TPSA) | 65.00 Ų |
| XlogP | 4.50 |
| There are no found synonyms. |
![2D Structure of 15-Hydroxy-17-methoxy-5-methyl-3,4-dioxabicyclo[11.4.0]heptadeca-1(13),11,14,16-tetraen-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/15-hydroxy-17-methoxy-5-methyl-34-dioxabicyclo1140heptadeca-113111416-tetraen-2-one.jpg "2D Structure of 15-Hydroxy-17-methoxy-5-methyl-3,4-dioxabicyclo[11.4.0]heptadeca-1(13),11,14,16-tetraen-2-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.64% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.21% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.83% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.04% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.53% | 98.75% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.99% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.51% | 97.09% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.04% | 92.62% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.85% | 92.94% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.35% | 89.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.96% | 90.00% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 85.63% | 99.18% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.50% | 95.89% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.51% | 97.14% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.78% | 99.23% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.95% | 91.07% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.71% | 96.21% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.31% | 97.25% |
| CHEMBL2664 | P23526 | Adenosylhomocysteinase | 81.30% | 86.67% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.56% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Rhaphidophora decursiva |
| PubChem | 85079474 |
| LOTUS | LTS0218520 |
| wikiData | Q105347354 |