15-Ethyl-1,11-diazapentacyclo[9.7.1.02,7.08,19.015,19]nonadeca-2,4,6,8-tetraene-10,18-dione
| Internal ID | 230f542a-f8fc-4d2c-9332-8dcd593786b9 |
| Taxonomy | Alkaloids and derivatives > Rhazinilam alkaloids |
| IUPAC Name | 15-ethyl-1,11-diazapentacyclo[9.7.1.02,7.08,19.015,19]nonadeca-2,4,6,8-tetraene-10,18-dione |
| SMILES (Canonical) | CCC12CCCN3C14C(=CC3=O)C5=CC=CC=C5N4C(=O)CC2 |
| SMILES (Isomeric) | CCC12CCCN3C14C(=CC3=O)C5=CC=CC=C5N4C(=O)CC2 |
| InChI | InChI=1S/C19H20N2O2/c1-2-18-9-5-11-20-17(23)12-14-13-6-3-4-7-15(13)21(19(14,18)20)16(22)8-10-18/h3-4,6-7,12H,2,5,8-11H2,1H3 |
| InChI Key | LUXCFVAZXZITNG-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.152477885 g/mol |
| Topological Polar Surface Area (TPSA) | 40.60 Ų |
| XlogP | 1.70 |
| 1207530-25-3 |
![2D Structure of 15-Ethyl-1,11-diazapentacyclo[9.7.1.02,7.08,19.015,19]nonadeca-2,4,6,8-tetraene-10,18-dione](https://plantaedb.com/storage/docs/compounds/2023/11/15-ethyl-111-diazapentacyclo971027081901519nonadeca-2468-tetraene-1018-dione.jpg "2D Structure of 15-Ethyl-1,11-diazapentacyclo[9.7.1.02,7.08,19.015,19]nonadeca-2,4,6,8-tetraene-10,18-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 97.18% | 89.63% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.02% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.01% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.96% | 96.09% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 93.80% | 82.69% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.29% | 86.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.00% | 91.11% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.98% | 90.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.05% | 90.17% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 86.58% | 92.67% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 83.57% | 90.24% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 83.33% | 96.67% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.72% | 97.25% |
| CHEMBL5028 | O14672 | ADAM10 | 80.61% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Kopsia singapurensis |
| PubChem | 75058267 |
| LOTUS | LTS0156325 |
| wikiData | Q105157679 |