1,5-Dimethyl-8-prop-1-en-2-yltricyclo[5.3.0.02,6]decane
| Internal ID | 5fe4297c-5a26-45e8-9bdf-5db432f55b09 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | 1,5-dimethyl-8-prop-1-en-2-yltricyclo[5.3.0.02,6]decane |
| SMILES (Canonical) | CC1CCC2C1C3C2(CCC3C(=C)C)C |
| SMILES (Isomeric) | CC1CCC2C1C3C2(CCC3C(=C)C)C |
| InChI | InChI=1S/C15H24/c1-9(2)11-7-8-15(4)12-6-5-10(3)13(12)14(11)15/h10-14H,1,5-8H2,2-4H3 |
| InChI Key | KZVOHANKAKKFOK-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 g/mol |
| Exact Mass | 204.187800766 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 5.50 |
| There are no found synonyms. |
![2D Structure of 1,5-Dimethyl-8-prop-1-en-2-yltricyclo[5.3.0.02,6]decane](https://plantaedb.com/storage/docs/compounds/2023/11/15-dimethyl-8-prop-1-en-2-yltricyclo530026decane.jpg "2D Structure of 1,5-Dimethyl-8-prop-1-en-2-yltricyclo[5.3.0.02,6]decane")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 95.35% | 96.38% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.19% | 96.09% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 90.96% | 96.61% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.48% | 91.11% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 88.94% | 83.82% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.65% | 92.94% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.62% | 97.25% |
| CHEMBL233 | P35372 | Mu opioid receptor | 87.16% | 97.93% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 86.93% | 93.04% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.36% | 100.00% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 82.65% | 97.64% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.56% | 82.69% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 80.48% | 92.86% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.47% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Frullania tamarisci |
| Tritomaria quinquedentata |
| PubChem | 85157423 |
| LOTUS | LTS0210560 |
| wikiData | Q104170745 |